Difference between revisions of "Ec-03 004790"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9852 CPD-9852] == * smiles: ** CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=...")
 
(Created page with "Category:Gene == Gene Ec-03_004790 == * left end position: ** 5683400 * transcription direction: ** POSITIVE * right end position: ** 5694615 * centisome position: ** 87.0...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9852 CPD-9852] ==
+
== Gene Ec-03_004790 ==
−
* smiles:
+
* left end position:
−
** CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C)C
+
** 5683400
−
* inchi key:
+
* transcription direction:
−
** InChIKey=PEMFGDIFKKXFRG-PYHSYOTJSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 3-heptaprenyl-4-hydroxybenzoate
+
** 5694615
−
* molecular weight:
+
* centisome position:
−
** 613.942    
+
** 87.05307    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0050_0061
 +
** Esi0050_0061
 +
** GRX
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-982]]
−
* [[RXN-9222]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-4621]]
 +
* [[PWY-4202]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=5683400}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54740346 54740346]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=5694615}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84496 84496]
+
{{#set: centisome position=87.05307    }}
−
{{#set: smiles=CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C)C}}
+
{{#set: common name=Esi_0050_0061|Esi0050_0061|GRX}}
−
{{#set: inchi key=InChIKey=PEMFGDIFKKXFRG-PYHSYOTJSA-M}}
+
{{#set: reaction associated=RXN-982}}
−
{{#set: common name=3-heptaprenyl-4-hydroxybenzoate}}
+
{{#set: pathway associated=PWY-4621|PWY-4202}}
−
{{#set: molecular weight=613.942    }}
+
−
{{#set: produced by=RXN-9222}}
+

Latest revision as of 19:32, 21 March 2018

Gene Ec-03_004790

  • left end position:
    • 5683400
  • transcription direction:
    • POSITIVE
  • right end position:
    • 5694615
  • centisome position:
    • 87.05307
  • Synonym(s):
    • Esi_0050_0061
    • Esi0050_0061
    • GRX

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-03_004790&oldid=27617"