Difference between revisions of "IMP-DEHYDROG-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL-PYRUVATE PHENYL-PYRUVATE] == * smiles: ** C([O-])(=O)C(=O)CC1(=CC=CC=C1) * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=IMP-DEHYDROG-RXN IMP-DEHYDROG-RXN] == * direction: ** REVERSIBLE * common name: ** IMP dehydrogenas...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=IMP-DEHYDROG-RXN IMP-DEHYDROG-RXN] == |
− | + | * direction: | |
− | + | ** REVERSIBLE | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** IMP dehydrogenase/GMP reductase |
− | * | + | ** IMP dehydrogenase |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/1.1.1.205 EC-1.1.1.205] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[NAD]][c] '''+''' 1 [[IMP]][c] '''+''' 1 [[WATER]][c] '''<=>''' 1 [[XANTHOSINE-5-PHOSPHATE]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] |
− | == | + | * With common name(s): |
− | == | + | ** 1 NAD+[c] '''+''' 1 IMP[c] '''+''' 1 H2O[c] '''<=>''' 1 XMP[c] '''+''' 1 NADH[c] '''+''' 1 H+[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | * [[ | + | * Gene: [[Ec-24_002410]] |
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Gene: [[Ec-19_000030]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways == | ||
+ | * [[PWY-7221]], guanosine ribonucleotides de novo biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7221 PWY-7221] | ||
+ | ** '''4''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[PWY-5695]], urate biosynthesis/inosine 5'-phosphate degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5695 PWY-5695] | ||
+ | ** '''3''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[PWY-6596]], adenosine nucleotides degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6596 PWY-6596] | ||
+ | ** '''6''' reactions found over '''8''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | * | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11708 11708] |
− | * | + | * LIGAND-RXN: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01130 R01130] |
− | * | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/P12268 P12268] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P21620 P21620] |
− | * | + | ** [http://www.uniprot.org/uniprot/P50098 P50098] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P50097 P50097] |
− | * | + | ** [http://www.uniprot.org/uniprot/O26245 O26245] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9PAR5 Q9PAR5] |
− | * | + | ** [http://www.uniprot.org/uniprot/P65172 P65172] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9X168 Q9X168] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9KTW3 Q9KTW3] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/Q9YBU2 Q9YBU2] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9CIY6 Q9CIY6] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P21879 P21879] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P0ADG7 P0ADG7] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P56088 P56088] |
+ | ** [http://www.uniprot.org/uniprot/P49058 P49058] | ||
+ | ** [http://www.uniprot.org/uniprot/O58045 O58045] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9UY49 Q9UY49] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9PKM2 Q9PKM2] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9RT87 Q9RT87] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9JUD0 Q9JUD0] | ||
+ | ** [http://www.uniprot.org/uniprot/Q59011 Q59011] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9PNN3 Q9PNN3] | ||
+ | ** [http://www.uniprot.org/uniprot/P44334 P44334] | ||
+ | ** [http://www.uniprot.org/uniprot/O67820 O67820] | ||
+ | ** [http://www.uniprot.org/uniprot/P65167 P65167] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9ZL14 Q9ZL14] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9JZB5 Q9JZB5] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9HXM5 Q9HXM5] | ||
+ | ** [http://www.uniprot.org/uniprot/P0C0H6 P0C0H6] | ||
+ | ** [http://www.uniprot.org/uniprot/P42851 P42851] | ||
+ | ** [http://www.uniprot.org/uniprot/P47996 P47996] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9RHG9 Q9RHG9] | ||
+ | ** [http://www.uniprot.org/uniprot/P24547 P24547] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9RHG1 Q9RHG1] | ||
+ | ** [http://www.uniprot.org/uniprot/P31002 P31002] | ||
+ | ** [http://www.uniprot.org/uniprot/Q07152 Q07152] | ||
+ | ** [http://www.uniprot.org/uniprot/P38697 P38697] | ||
+ | ** [http://www.uniprot.org/uniprot/P50094 P50094] | ||
+ | ** [http://www.uniprot.org/uniprot/P39567 P39567] | ||
+ | ** [http://www.uniprot.org/uniprot/P50095 P50095] | ||
+ | ** [http://www.uniprot.org/uniprot/Q49729 Q49729] | ||
+ | ** [http://www.uniprot.org/uniprot/O14344 O14344] | ||
+ | ** [http://www.uniprot.org/uniprot/O32912 O32912] | ||
+ | {{#set: direction=REVERSIBLE}} | ||
+ | {{#set: common name=IMP dehydrogenase/GMP reductase}} | ||
+ | {{#set: common name=IMP dehydrogenase}} | ||
+ | {{#set: ec number=EC-1.1.1.205}} | ||
+ | {{#set: gene associated=Ec-24_002410|Ec-19_000030}} | ||
+ | {{#set: in pathway=PWY-7221|PWY-5695|PWY-6596}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 19:32, 21 March 2018
Contents
Reaction IMP-DEHYDROG-RXN
- direction:
- REVERSIBLE
- common name:
- IMP dehydrogenase/GMP reductase
- IMP dehydrogenase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 NAD+[c] + 1 IMP[c] + 1 H2O[c] <=> 1 XMP[c] + 1 NADH[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-24_002410
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome
- Gene: Ec-19_000030
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome
Pathways
- PWY-7221, guanosine ribonucleotides de novo biosynthesis: PWY-7221
- 4 reactions found over 4 reactions in the full pathway
- PWY-5695, urate biosynthesis/inosine 5'-phosphate degradation: PWY-5695
- 3 reactions found over 4 reactions in the full pathway
- PWY-6596, adenosine nucleotides degradation I: PWY-6596
- 6 reactions found over 8 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT:
- P12268
- P21620
- P50098
- P50097
- O26245
- Q9PAR5
- P65172
- Q9X168
- Q9KTW3
- Q9YBU2
- Q9CIY6
- P21879
- P0ADG7
- P56088
- P49058
- O58045
- Q9UY49
- Q9PKM2
- Q9RT87
- Q9JUD0
- Q59011
- Q9PNN3
- P44334
- O67820
- P65167
- Q9ZL14
- Q9JZB5
- Q9HXM5
- P0C0H6
- P42851
- P47996
- Q9RHG9
- P24547
- Q9RHG1
- P31002
- Q07152
- P38697
- P50094
- P39567
- P50095
- Q49729
- O14344
- O32912