Difference between revisions of "DEOXYRIBODIPYRIMIDINE-PHOTOLYASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-488 CPD-488] == * smiles: ** CC1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * inchi key: ** InChIKe...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DEOXYRIBODIPYRIMIDINE-PHOTOLYASE-RXN DEOXYRIBODIPYRIMIDINE-PHOTOLYASE-RXN] == * direction: ** LEFT-...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DEOXYRIBODIPYRIMIDINE-PHOTOLYASE-RXN DEOXYRIBODIPYRIMIDINE-PHOTOLYASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** DNA photolyase |
− | * | + | ** deoxyribodipyrimidine photo-lyase |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/4.1.99.3 EC-4.1.99.3] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1 [[DNA-With-Pyrimidine-Dimers]][c] '''=>''' 1 [[DNA-Adjacent-Pyrimidines]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-01_008100]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-10_005990]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-16_001260]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-01_008080]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-RXN: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00034 R00034] |
− | * | + | * UNIPROT: |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P12769 P12769] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9JSP8 Q9JSP8] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9HQ46 Q9HQ46] |
− | * | + | ** [http://www.uniprot.org/uniprot/P12768 P12768] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P27526 P27526] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P25078 P25078] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/Q43125 Q43125] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P40115 P40115] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q28811 Q28811] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q24443 Q24443] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q91186 Q91186] |
+ | ** [http://www.uniprot.org/uniprot/Q42696 Q42696] | ||
+ | ** [http://www.uniprot.org/uniprot/P05066 P05066] | ||
+ | ** [http://www.uniprot.org/uniprot/O24020 O24020] | ||
+ | ** [http://www.uniprot.org/uniprot/O24374 O24374] | ||
+ | ** [http://www.uniprot.org/uniprot/P00914 P00914] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=DNA photolyase}} | ||
+ | {{#set: common name=deoxyribodipyrimidine photo-lyase}} | ||
+ | {{#set: ec number=EC-4.1.99.3}} | ||
+ | {{#set: gene associated=Ec-01_008100|Ec-10_005990|Ec-16_001260|Ec-01_008080}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 19:02, 21 March 2018
Contents
Reaction DEOXYRIBODIPYRIMIDINE-PHOTOLYASE-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- DNA photolyase
- deoxyribodipyrimidine photo-lyase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 DNA-With-Pyrimidine-Dimers[c] => 1 DNA-Adjacent-Pyrimidines[c]
- With common name(s):
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-01_008100
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-10_005990
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-16_001260
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-01_008080
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- LIGAND-RXN:
- UNIPROT: