Difference between revisions of "CPD-7105"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-476 RXN66-476] == * direction: ** LEFT-TO-RIGHT * common name: ** fatty aldehyde dehydrogenas...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7105 CPD-7105] == * smiles: ** CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(CC(C)C)=O)O))C * inc...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-476 RXN66-476] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7105 CPD-7105] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(CC(C)C)=O)O))C
 +
* inchi key:
 +
** InChIKey=NQYBQBZOHCACCR-UHFFFAOYSA-M
 
* common name:
 
* common name:
−
** fatty aldehyde dehydrogenase
+
** diprenylphlorisovalerophenone
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.2.1.3 EC-1.2.1.3]
+
** 345.458   
 
* Synonym(s):
 
* Synonym(s):
 +
** deoxyhumulone
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[Odd-Straight-Chain-234-Sat-FALD]][c] '''+''' 1 [[NAD]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Odd-Straight-Chain-234-Sat-FA]][c] '''+''' 1 [[NADH]][c] '''+''' 2 [[PROTON]][c]
+
* [[RXN-7810]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 an odd numbered straight chain 2,3,4-saturated fatty aldehyde[c] '''+''' 1 NAD+[c] '''+''' 1 H2O[c] '''=>''' 1 an odd numbered straight chain 2,3,4-saturated fatty acid[c] '''+''' 1 NADH[c] '''+''' 2 H+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY66-388]], fatty acid α-oxidation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-388 PWY66-388]
+
−
** '''4''' reactions found over '''7''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=fatty aldehyde dehydrogenase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203000 25203000]
−
{{#set: ec number=EC-1.2.1.3}}
+
{{#set: smiles=CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(CC(C)C)=O)O))C}}
−
{{#set: in pathway=PWY66-388}}
+
{{#set: inchi key=InChIKey=NQYBQBZOHCACCR-UHFFFAOYSA-M}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: common name=diprenylphlorisovalerophenone}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: molecular weight=345.458    }}
−
{{#set: reconstruction source=esiliculosus_genome}}
+
{{#set: common name=deoxyhumulone}}
 +
{{#set: produced by=RXN-7810}}

Latest revision as of 19:33, 21 March 2018

Metabolite CPD-7105

  • smiles:
    • CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(CC(C)C)=O)O))C
  • inchi key:
    • InChIKey=NQYBQBZOHCACCR-UHFFFAOYSA-M
  • common name:
    • diprenylphlorisovalerophenone
  • molecular weight:
    • 345.458
  • Synonym(s):
    • deoxyhumulone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(CC(C)C)=O)O))C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-7105&oldid=27678"