Difference between revisions of "Ec-01 003910"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7105 CPD-7105] == * smiles: ** CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(CC(C)C)=O)O))C * inc...") |
(Created page with "Category:Gene == Gene Ec-01_003910 == * left end position: ** 3280609 * transcription direction: ** NEGATIVE * right end position: ** 3285067 * centisome position: ** 31.7...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-01_003910 == |
− | * | + | * left end position: |
− | ** | + | ** 3280609 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 3285067 |
− | * | + | * centisome position: |
− | ** | + | ** 31.792439 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0003_0340 |
+ | ** Esi0003_0340 | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3280609}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | {{#set: | + | {{#set: right end position=3285067}} |
− | {{#set: | + | {{#set: centisome position=31.792439 }} |
− | {{#set: | + | {{#set: common name=Esi_0003_0340|Esi0003_0340}} |
− | {{#set: | + | {{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}} |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:33, 21 March 2018
Gene Ec-01_003910
- left end position:
- 3280609
- transcription direction:
- NEGATIVE
- right end position:
- 3285067
- centisome position:
- 31.792439
- Synonym(s):
- Esi_0003_0340
- Esi0003_0340
Reactions associated
- Reaction: PEPTIDYLPROLYL-ISOMERASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome