Difference between revisions of "Ec-01 003910"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7105 CPD-7105] == * smiles: ** CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(CC(C)C)=O)O))C * inc...")
 
(Created page with "Category:Gene == Gene Ec-01_003910 == * left end position: ** 3280609 * transcription direction: ** NEGATIVE * right end position: ** 3285067 * centisome position: ** 31.7...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7105 CPD-7105] ==
+
== Gene Ec-01_003910 ==
−
* smiles:
+
* left end position:
−
** CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(CC(C)C)=O)O))C
+
** 3280609
−
* inchi key:
+
* transcription direction:
−
** InChIKey=NQYBQBZOHCACCR-UHFFFAOYSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** diprenylphlorisovalerophenone
+
** 3285067
−
* molecular weight:
+
* centisome position:
−
** 345.458    
+
** 31.792439    
 
* Synonym(s):
 
* Synonym(s):
−
** deoxyhumulone
+
** Esi_0003_0340
 +
** Esi0003_0340
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
−
* [[RXN-7810]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3280609}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203000 25203000]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(CC(C)C)=O)O))C}}
+
{{#set: right end position=3285067}}
−
{{#set: inchi key=InChIKey=NQYBQBZOHCACCR-UHFFFAOYSA-M}}
+
{{#set: centisome position=31.792439   }}
−
{{#set: common name=diprenylphlorisovalerophenone}}
+
{{#set: common name=Esi_0003_0340|Esi0003_0340}}
−
{{#set: molecular weight=345.458   }}
+
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
−
{{#set: common name=deoxyhumulone}}
+
−
{{#set: produced by=RXN-7810}}
+

Latest revision as of 19:33, 21 March 2018

Gene Ec-01_003910

  • left end position:
    • 3280609
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3285067
  • centisome position:
    • 31.792439
  • Synonym(s):
    • Esi_0003_0340
    • Esi0003_0340

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-01_003910&oldid=27686"