Difference between revisions of "Ec-16 002230"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DI-H-OROTATE DI-H-OROTATE] == * smiles: ** C1(C(=O)NC(=O)NC(C(=O)[O-])1) * inchi key: ** InChIK...") |
(Created page with "Category:Gene == Gene Ec-16_002230 == * left end position: ** 2446637 * transcription direction: ** POSITIVE * right end position: ** 2457426 * centisome position: ** 45.8...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-16_002230 == |
− | * | + | * left end position: |
− | ** | + | ** 2446637 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2457426 |
− | * | + | * centisome position: |
− | ** | + | ** 45.83731 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0047_0020 |
− | ** | + | ** Esi0047_0020 |
− | ** | + | ** CDPK |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[PROTEIN-KINASE-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: ec-number |
− | + | == Pathways associated == | |
− | * | + | |
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2446637}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=2457426}} | |
− | + | {{#set: centisome position=45.83731 }} | |
− | + | {{#set: common name=Esi_0047_0020|Esi0047_0020|CDPK}} | |
− | + | {{#set: reaction associated=PROTEIN-KINASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:33, 21 March 2018
Gene Ec-16_002230
- left end position:
- 2446637
- transcription direction:
- POSITIVE
- right end position:
- 2457426
- centisome position:
- 45.83731
- Synonym(s):
- Esi_0047_0020
- Esi0047_0020
- CDPK
Reactions associated
- Reaction: PROTEIN-KINASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome