Difference between revisions of "RXN-10034"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OLEATE-CPD OLEATE-CPD] == * smiles: ** CCCCCCCCC=CCCCCCCCC([O-])=O * inchi key: ** InChIKey=ZQP...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10034 RXN-10034] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10034 RXN-10034] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | * ec number: | |
| − | + | ** [http://enzyme.expasy.org/EC/3.1.3.84 EC-3.1.3.84] | |
| − | * | + | |
| − | ** | + | |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | * [[ | + | ** 1 [[WATER]][c] '''+''' 1 [[CPD-10794]][c] '''=>''' 1 [[ADENOSINE_DIPHOSPHATE_RIBOSE]][c] '''+''' 1 [[Pi]][c] |
| − | == | + | * With common name(s): |
| − | * [[ | + | ** 1 H2O[c] '''+''' 1 ADP ribose 1''-phosphate[c] '''=>''' 1 ADP-D-ribose[c] '''+''' 1 phosphate[c] |
| − | * [[ | + | |
| − | * [[ | + | == Genes associated with this reaction == |
| − | + | == Pathways == | |
| + | * [[PWY-6689]], tRNA splicing: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6689 PWY-6689] | ||
| + | ** '''5''' reactions found over '''5''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | * | + | * RHEA: |
| − | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25032 25032] | |
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: ec number=EC-3.1.3.84}} | |
| − | + | {{#set: in pathway=PWY-6689}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | ** [http://www.ebi.ac.uk/ | + | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 19:33, 21 March 2018
Contents
Reaction RXN-10034
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 CPD-10794[c] => 1 ADENOSINE_DIPHOSPHATE_RIBOSE[c] + 1 Pi[c]
- With common name(s):
- 1 H2O[c] + 1 ADP ribose 1-phosphate[c] => 1 ADP-D-ribose[c] + 1 phosphate[c]
Genes associated with this reaction
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- RHEA:
