Difference between revisions of "Ec-10 000640"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14705 CPD-14705] == * smiles: ** CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O * inchi key:...")
 
(Created page with "Category:Gene == Gene Ec-10_000640 == * left end position: ** 715343 * transcription direction: ** POSITIVE * right end position: ** 723104 * centisome position: ** 11.003...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14705 CPD-14705] ==
+
== Gene Ec-10_000640 ==
−
* smiles:
+
* left end position:
−
** CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O
+
** 715343
−
* inchi key:
+
* transcription direction:
−
** InChIKey=LQTWZQSULMRBEE-UHFFFAOYSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 4-hydroxy-2-nonenal-[Cys-Gly] conjugate
+
** 723104
−
* molecular weight:
+
* centisome position:
−
** 334.43    
+
** 11.00361    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0138_0032
 +
** Esi0138_0032
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-13677]]
+
* Reaction: [[PROTEIN-KINASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=715343}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659346 90659346]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O}}
+
{{#set: right end position=723104}}
−
{{#set: inchi key=InChIKey=LQTWZQSULMRBEE-UHFFFAOYSA-N}}
+
{{#set: centisome position=11.00361    }}
−
{{#set: common name=4-hydroxy-2-nonenal-[Cys-Gly] conjugate}}
+
{{#set: common name=Esi_0138_0032|Esi0138_0032}}
−
{{#set: molecular weight=334.43    }}
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
−
{{#set: consumed by=RXN-13677}}
+

Latest revision as of 19:33, 21 March 2018

Gene Ec-10_000640

  • left end position:
    • 715343
  • transcription direction:
    • POSITIVE
  • right end position:
    • 723104
  • centisome position:
    • 11.00361
  • Synonym(s):
    • Esi_0138_0032
    • Esi0138_0032

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-10_000640&oldid=27796"