Difference between revisions of "CPD-4617"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-19_003680 == * left end position: ** 3926141 * transcription direction: ** NEGATIVE * right end position: ** 3927566 * centisome position: ** 65.7...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4617 CPD-4617] == * smiles: ** CC(CCNC1(C2(=C(N=CN=1)NC=N2)))COC3(C(C(C(C(O3)CO)O)O)O) * in...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4617 CPD-4617] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(CCNC1(C2(=C(N=CN=1)NC=N2)))COC3(C(C(C(C(O3)CO)O)O)O) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=QRZHDHJUYBONQQ-JSYMRTRDSA-N |
| − | * | + | * common name: |
| − | ** | + | ** dihydrozeatin-O-glucoside |
| − | * | + | * molecular weight: |
| − | ** | + | ** 383.403 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-4726]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658286 90658286] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16448 C16448] |
| − | {{#set: | + | * HMDB : HMDB12214 |
| − | {{#set: | + | {{#set: smiles=CC(CCNC1(C2(=C(N=CN=1)NC=N2)))COC3(C(C(C(C(O3)CO)O)O)O)}} |
| + | {{#set: inchi key=InChIKey=QRZHDHJUYBONQQ-JSYMRTRDSA-N}} | ||
| + | {{#set: common name=dihydrozeatin-O-glucoside}} | ||
| + | {{#set: molecular weight=383.403 }} | ||
| + | {{#set: produced by=RXN-4726}} | ||
Latest revision as of 19:34, 21 March 2018
Contents
Metabolite CPD-4617
- smiles:
- CC(CCNC1(C2(=C(N=CN=1)NC=N2)))COC3(C(C(C(C(O3)CO)O)O)O)
- inchi key:
- InChIKey=QRZHDHJUYBONQQ-JSYMRTRDSA-N
- common name:
- dihydrozeatin-O-glucoside
- molecular weight:
- 383.403
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
