Difference between revisions of "CPD-16825"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-14_005830 == * left end position: ** 5387086 * transcription direction: ** NEGATIVE * right end position: ** 5399299 * centisome position: ** 82.1...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16825 CPD-16825] == * smiles: ** C1(C=C(C=C2(OCC(CC=12)C3(C=CC(=CC=3)OS([O-])(=O)=O)))O) *...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16825 CPD-16825] == |
| − | * | + | * smiles: |
| − | ** | + | ** C1(C=C(C=C2(OCC(CC=12)C3(C=CC(=CC=3)OS([O-])(=O)=O)))O) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=UXOJWGSGKUYMIA-GFCCVEGCSA-M |
| − | * | + | * common name: |
| − | ** | + | ** (S)-equol 4'-sulfate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 321.324 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 4',7-isoflavandiol 4'-sulfate |
| − | + | ||
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-15589]] | |
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=29979373 29979373] |
| − | {{#set: | + | {{#set: smiles=C1(C=C(C=C2(OCC(CC=12)C3(C=CC(=CC=3)OS([O-])(=O)=O)))O)}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=UXOJWGSGKUYMIA-GFCCVEGCSA-M}} |
| − | {{#set: common name= | + | {{#set: common name=(S)-equol 4'-sulfate}} |
| − | {{#set: reaction associated=RXN- | + | {{#set: molecular weight=321.324 }} |
| − | + | {{#set: common name=4',7-isoflavandiol 4'-sulfate}} | |
| + | {{#set: reversible reaction associated=RXN-15589}} | ||
Latest revision as of 19:34, 21 March 2018
Contents
Metabolite CPD-16825
- smiles:
- C1(C=C(C=C2(OCC(CC=12)C3(C=CC(=CC=3)OS([O-])(=O)=O)))O)
- inchi key:
- InChIKey=UXOJWGSGKUYMIA-GFCCVEGCSA-M
- common name:
- (S)-equol 4'-sulfate
- molecular weight:
- 321.324
- Synonym(s):
- 4',7-isoflavandiol 4'-sulfate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C1(C=C(C=C2(OCC(CC=12)C3(C=CC(=CC=3)OS([O-])(=O)=O)))O)" cannot be used as a page name in this wiki.
