Difference between revisions of "Ec-11 000900"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8610 CPD-8610] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C...")
 
(Created page with "Category:Gene == Gene Ec-11_000900 == * left end position: ** 971559 * transcription direction: ** POSITIVE * right end position: ** 979678 * centisome position: ** 15.446...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8610 CPD-8610] ==
+
== Gene Ec-11_000900 ==
−
* smiles:
+
* left end position:
−
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
+
** 971559
−
* inchi key:
+
* transcription direction:
−
** InChIKey=FYHRVINOXYETMN-QGBOJXOESA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 4,4-dimethyl-5α-cholesta-8-en-3-β-ol
+
** 979678
−
* molecular weight:
+
* centisome position:
−
** 414.713    
+
** 15.44693    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0102_0048
 +
** Esi0102_0048
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PROTEIN-KINASE-RXN]]
−
* [[RXN66-14]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=971559}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23427666 23427666]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEMSPIDER:
+
{{#set: right end position=979678}}
−
** [http://www.chemspider.com/Chemical-Structure.10474091.html 10474091]
+
{{#set: centisome position=15.44693    }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0102_0048|Esi0102_0048}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15915 C15915]
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
−
* HMDB : HMDB06840
+
−
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}}
+
−
{{#set: inchi key=InChIKey=FYHRVINOXYETMN-QGBOJXOESA-N}}
+
−
{{#set: common name=4,4-dimethyl-5α-cholesta-8-en-3-β-ol}}
+
−
{{#set: molecular weight=414.713    }}
+
−
{{#set: produced by=RXN66-14}}
+

Latest revision as of 19:34, 21 March 2018

Gene Ec-11_000900

  • left end position:
    • 971559
  • transcription direction:
    • POSITIVE
  • right end position:
    • 979678
  • centisome position:
    • 15.44693
  • Synonym(s):
    • Esi_0102_0048
    • Esi0102_0048

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-11_000900&oldid=27854"