Difference between revisions of "PWY0-1534"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-BETA-D-GLUCOSYLGLUCOSE 3-BETA-D-GLUCOSYLGLUCOSE] == * smiles: ** C(O)C2(C(O)C(O)C(O)C(OC1(C(O...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1534 PWY0-1534] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-BETA-D-GLUCOSYLGLUCOSE 3-BETA-D-GLUCOSYLGLUCOSE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1534 PWY0-1534] ==
* smiles:
+
* taxonomic range:
** C(O)C2(C(O)C(O)C(O)C(OC1(C(O)C(O)OC(CO)C(O)1))O2)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=QIGJYVCQYDKYDW-NSYYTRPSSA-N
+
 
* common name:
 
* common name:
** nigerose
+
** hydrogen sulfide biosynthesis I
* molecular weight:
+
** 342.299   
+
 
* Synonym(s):
 
* Synonym(s):
** α-1,3-glucose disaccharide
 
** sakebiose
 
** 3-O-α-D-glucopyranosyl-D-glucopyranose
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN0-5395]]
+
'''1''' reactions found over '''2''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[CYSTEINE-AMINOTRANSFERASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Ec-03_003270]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6945 RXN0-6945]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439512 439512]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-1534 PWY0-1534]
* CHEBI:
+
{{#set: taxonomic range=TAX-2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=7570 7570]
+
{{#set: common name=hydrogen sulfide biosynthesis I}}
* LIGAND-CPD:
+
{{#set: reaction found=1}}
** [http://www.genome.jp/dbget-bin/www_bget?C01518 C01518]
+
{{#set: total reaction=2}}
* HMDB : HMDB29882
+
{{#set: completion rate=50.0}}
{{#set: smiles=C(O)C2(C(O)C(O)C(O)C(OC1(C(O)C(O)OC(CO)C(O)1))O2)}}
+
{{#set: inchi key=InChIKey=QIGJYVCQYDKYDW-NSYYTRPSSA-N}}
+
{{#set: common name=nigerose}}
+
{{#set: molecular weight=342.299    }}
+
{{#set: common name=α-1,3-glucose disaccharide|sakebiose|3-O-α-D-glucopyranosyl-D-glucopyranose}}
+
{{#set: consumed by=RXN0-5395}}
+

Latest revision as of 20:34, 21 March 2018

Pathway PWY0-1534

  • taxonomic range:
  • common name:
    • hydrogen sulfide biosynthesis I
  • Synonym(s):

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links