Difference between revisions of "3-BETA-D-GLUCOSYLGLUCOSE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAMINE PYRIDOXAMINE] == * smiles: ** CC1(=NC=C(CO)C(C[N+])=C(O)1) * inchi key: ** InChIKe...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-BETA-D-GLUCOSYLGLUCOSE 3-BETA-D-GLUCOSYLGLUCOSE] == * smiles: ** C(O)C2(C(O)C(O)C(O)C(OC1(C(O...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-BETA-D-GLUCOSYLGLUCOSE 3-BETA-D-GLUCOSYLGLUCOSE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(O)C2(C(O)C(O)C(O)C(OC1(C(O)C(O)OC(CO)C(O)1))O2) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=QIGJYVCQYDKYDW-NSYYTRPSSA-N |
* common name: | * common name: | ||
| − | ** | + | ** nigerose |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 342.299 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** α-1,3-glucose disaccharide |
| + | ** sakebiose | ||
| + | ** 3-O-α-D-glucopyranosyl-D-glucopyranose | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-5395]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439512 439512] |
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=7570 7570] |
| − | * | + | * LIGAND-CPD: |
| − | {{#set: smiles= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01518 C01518] |
| − | {{#set: inchi key=InChIKey= | + | * HMDB : HMDB29882 |
| − | {{#set: common name= | + | {{#set: smiles=C(O)C2(C(O)C(O)C(O)C(OC1(C(O)C(O)OC(CO)C(O)1))O2)}} |
| − | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=QIGJYVCQYDKYDW-NSYYTRPSSA-N}} |
| − | {{#set: common name= | + | {{#set: common name=nigerose}} |
| − | {{#set: consumed by= | + | {{#set: molecular weight=342.299 }} |
| + | {{#set: common name=α-1,3-glucose disaccharide|sakebiose|3-O-α-D-glucopyranosyl-D-glucopyranose}} | ||
| + | {{#set: consumed by=RXN0-5395}} | ||
Latest revision as of 19:34, 21 March 2018
Contents
Metabolite 3-BETA-D-GLUCOSYLGLUCOSE
- smiles:
- C(O)C2(C(O)C(O)C(O)C(OC1(C(O)C(O)OC(CO)C(O)1))O2)
- inchi key:
- InChIKey=QIGJYVCQYDKYDW-NSYYTRPSSA-N
- common name:
- nigerose
- molecular weight:
- 342.299
- Synonym(s):
- α-1,3-glucose disaccharide
- sakebiose
- 3-O-α-D-glucopyranosyl-D-glucopyranose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
