Difference between revisions of "Ec-14 002740"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XYLULOSE-5-PHOSPHATE XYLULOSE-5-PHOSPHATE] == * smiles: ** C(OP([O-])(=O)[O-])C(O)C(O)C(=O)CO *...") |
(Created page with "Category:Gene == Gene Ec-14_002740 == * left end position: ** 2568218 * transcription direction: ** POSITIVE * right end position: ** 2568573 * centisome position: ** 39.1...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-14_002740 == |
− | * | + | * left end position: |
− | ** | + | ** 2568218 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2568573 |
− | * | + | * centisome position: |
− | ** | + | ** 39.14711 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0038_0163 |
− | ** | + | ** Esi0038_0163 |
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]] | |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | + | *** Assignment: automated-name-match | |
− | * [[ | + | == Pathways associated == |
− | * | + | |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2568218}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=2568573}} | |
− | + | {{#set: centisome position=39.14711 }} | |
− | + | {{#set: common name=Esi_0038_0163|Esi0038_0163}} | |
− | + | {{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:34, 21 March 2018
Gene Ec-14_002740
- left end position:
- 2568218
- transcription direction:
- POSITIVE
- right end position:
- 2568573
- centisome position:
- 39.14711
- Synonym(s):
- Esi_0038_0163
- Esi0038_0163
Reactions associated
- Reaction: PEPTIDYLPROLYL-ISOMERASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome