Difference between revisions of "PWY-801"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIS-ACONITATE CIS-ACONITATE] == * smiles: ** C([O-])(=O)C(=CC(=O)[O-])CC(=O)[O-] * inchi key: *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-801 PWY-801] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-330...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-801 PWY-801] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
| − | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
| − | * | + | |
* common name: | * common name: | ||
| − | ** | + | ** L-homocysteine and L-cysteine interconversion |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** transsulfuration pathway |
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''3''' reactions found over '''4''' reactions in the full pathway | |
| − | + | * [[CYSTATHIONINE-BETA-SYNTHASE-RXN]] | |
| − | * [[ | + | ** 1 associated gene(s): |
| − | * [[ | + | *** [[Ec-16_002870]] |
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[RXN-14048]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Ec-12_003100]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[RXN-15131]] | ||
| + | ** 2 associated gene(s): | ||
| + | *** [[Ec-00_002820]] | ||
| + | *** [[Ec-05_006760]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-721 RXN-721] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-33090}} | |
| − | + | {{#set: taxonomic range=TAX-4751}} | |
| − | + | {{#set: common name=L-homocysteine and L-cysteine interconversion}} | |
| − | + | {{#set: common name=transsulfuration pathway}} | |
| − | + | {{#set: reaction found=3}} | |
| − | + | {{#set: total reaction=4}} | |
| − | + | {{#set: completion rate=75.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:35, 21 March 2018
Pathway PWY-801
- taxonomic range:
- common name:
- L-homocysteine and L-cysteine interconversion
- Synonym(s):
- transsulfuration pathway
Reaction(s) found
3 reactions found over 4 reactions in the full pathway
- CYSTATHIONINE-BETA-SYNTHASE-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-14048
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-15131
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
