Difference between revisions of "N-ACETYL-D-GLUCOSAMINE-1-P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3R-11Z-3-hydroxy-icos-11-enoyl-ACPs 3R-11Z-3-hydroxy-icos-11-enoyl-ACPs] == * common name: ** a...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-GLUCOSAMINE-1-P N-ACETYL-D-GLUCOSAMINE-1-P] == * smiles: ** CC(=O)NC1(C(O)C(O)C(CO)O...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-GLUCOSAMINE-1-P N-ACETYL-D-GLUCOSAMINE-1-P] == |
+ | * smiles: | ||
+ | ** CC(=O)NC1(C(O)C(O)C(CO)OC(OP(=O)([O-])[O-])1) | ||
+ | * inchi key: | ||
+ | ** InChIKey=FZLJPEPAYPUMMR-FMDGEEDCSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** N-acetyl-α-D-glucosamine 1-phosphate |
+ | * molecular weight: | ||
+ | ** 299.174 | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[NAG1P-URIDYLTRANS-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[PHOSACETYLGLUCOSAMINEMUT-RXN]] | ||
+ | * [[RXN-16426]] | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04256 C04256] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57776 57776] | ||
+ | * BIGG : 43457 | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243937 25243937] | ||
+ | * HMDB : HMDB01367 | ||
+ | {{#set: smiles=CC(=O)NC1(C(O)C(O)C(CO)OC(OP(=O)([O-])[O-])1)}} | ||
+ | {{#set: inchi key=InChIKey=FZLJPEPAYPUMMR-FMDGEEDCSA-L}} | ||
+ | {{#set: common name=N-acetyl-α-D-glucosamine 1-phosphate}} | ||
+ | {{#set: molecular weight=299.174 }} | ||
+ | {{#set: consumed by=NAG1P-URIDYLTRANS-RXN}} | ||
+ | {{#set: reversible reaction associated=PHOSACETYLGLUCOSAMINEMUT-RXN|RXN-16426}} |
Latest revision as of 19:35, 21 March 2018
Contents
Metabolite N-ACETYL-D-GLUCOSAMINE-1-P
- smiles:
- CC(=O)NC1(C(O)C(O)C(CO)OC(OP(=O)([O-])[O-])1)
- inchi key:
- InChIKey=FZLJPEPAYPUMMR-FMDGEEDCSA-L
- common name:
- N-acetyl-α-D-glucosamine 1-phosphate
- molecular weight:
- 299.174
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=O)NC1(C(O)C(O)C(CO)OC(OP(=O)([O-])[O-])1)" cannot be used as a page name in this wiki.