Difference between revisions of "Ec-20 004590"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAMINE-5P PYRIDOXAMINE-5P] == * smiles: ** CC1(C(=C(C(COP([O-])([O-])=O)=CN=1)C[N+])O) *...") |
(Created page with "Category:Gene == Gene Ec-20_004590 == * left end position: ** 4686662 * transcription direction: ** POSITIVE * right end position: ** 4692429 * centisome position: ** 90.8...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-20_004590 == |
− | * | + | * left end position: |
− | ** | + | ** 4686662 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 4692429 |
− | * | + | * centisome position: |
− | ** | + | ** 90.889824 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0010_0193 |
− | ** | + | ** Esi0010_0193 |
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[6.3.2.25-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | == | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: left end position=4686662}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=4692429}} | |
− | + | {{#set: centisome position=90.889824 }} | |
− | + | {{#set: common name=Esi_0010_0193|Esi0010_0193}} | |
− | + | {{#set: reaction associated=6.3.2.25-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:35, 21 March 2018
Gene Ec-20_004590
- left end position:
- 4686662
- transcription direction:
- POSITIVE
- right end position:
- 4692429
- centisome position:
- 90.889824
- Synonym(s):
- Esi_0010_0193
- Esi0010_0193
Reactions associated
- Reaction: 6.3.2.25-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome