Difference between revisions of "Ec-16 004700"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-PRENYL-L-CYSTEINE S-PRENYL-L-CYSTEINE] == * smiles: ** CC(C)=CCSCC([N+])C(=O)[O-] * inchi key...")
 
(Created page with "Category:Gene == Gene Ec-16_004700 == * left end position: ** 4801309 * transcription direction: ** POSITIVE * right end position: ** 4805578 * centisome position: ** 89.9...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-PRENYL-L-CYSTEINE S-PRENYL-L-CYSTEINE] ==
+
== Gene Ec-16_004700 ==
−
* smiles:
+
* left end position:
−
** CC(C)=CCSCC([N+])C(=O)[O-]
+
** 4801309
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ULHWZNASVJIOEM-ZETCQYMHSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** S-prenyl-L-cysteine
+
** 4805578
−
* molecular weight:
+
* centisome position:
−
** 189.272    
+
** 89.95167    
 
* Synonym(s):
 
* Synonym(s):
−
** prenyl-L-cysteine
+
** Esi_0164_0059
 +
** Esi0164_0059
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[1.8.3.5-RXN]]
+
* Reaction: [[CARBODEHYDRAT-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
* Reaction: [[RXN0-5224]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-241]]
 +
* [[PWYQT-4429]]
 +
* [[PWY-7117]]
 +
* [[PWY-7115]]
 +
* [[PWY-6142]]
 +
* [[CYANCAT-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4801309}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200435 25200435]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=4805578}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47914 47914]
+
{{#set: centisome position=89.95167   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0164_0059|Esi0164_0059}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06751 C06751]
+
{{#set: reaction associated=CARBODEHYDRAT-RXN|RXN0-5224}}
−
* HMDB : HMDB12286
+
{{#set: pathway associated=PWY-241|PWYQT-4429|PWY-7117|PWY-7115|PWY-6142|CYANCAT-PWY}}
−
{{#set: smiles=CC(C)=CCSCC([N+])C(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=ULHWZNASVJIOEM-ZETCQYMHSA-N}}
+
−
{{#set: common name=S-prenyl-L-cysteine}}
+
−
{{#set: molecular weight=189.272   }}
+
−
{{#set: common name=prenyl-L-cysteine}}
+
−
{{#set: consumed by=1.8.3.5-RXN}}
+

Latest revision as of 19:35, 21 March 2018

Gene Ec-16_004700

  • left end position:
    • 4801309
  • transcription direction:
    • POSITIVE
  • right end position:
    • 4805578
  • centisome position:
    • 89.95167
  • Synonym(s):
    • Esi_0164_0059
    • Esi0164_0059

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-16_004700&oldid=28023"