Difference between revisions of "S-PRENYL-L-CYSTEINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15044 RXN-15044] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-PRENYL-L-CYSTEINE S-PRENYL-L-CYSTEINE] == * smiles: ** CC(C)=CCSCC([N+])C(=O)[O-] * inchi key...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15044 RXN-15044] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-PRENYL-L-CYSTEINE S-PRENYL-L-CYSTEINE] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CC(C)=CCSCC([N+])C(=O)[O-]
* ec number:
+
* inchi key:
** [http://enzyme.expasy.org/EC/2.3.1.42 EC-2.3.1.42]
+
** InChIKey=ULHWZNASVJIOEM-ZETCQYMHSA-N
 +
* common name:
 +
** S-prenyl-L-cysteine
 +
* molecular weight:
 +
** 189.272   
 
* Synonym(s):
 
* Synonym(s):
 +
** prenyl-L-cysteine
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[1.8.3.5-RXN]]
** 1 [[DIHYDROXY-ACETONE-PHOSPHATE]][c] '''+''' 1 [[OLEOYL-COA]][c] '''=>''' 1 [[CPD-15924]][c] '''+''' 1 [[CO-A]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 glycerone phosphate[c] '''+''' 1 oleoyl-CoA[c] '''=>''' 1 1-oleoyl-2-lyso-glycerone phosphate[c] '''+''' 1 coenzyme A[c]
+
 
+
== Genes associated with this reaction  ==
+
== Pathways  ==
+
* [[PWY-7411]], superpathway of phosphatidate biosynthesis (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7411 PWY-7411]
+
** '''5''' reactions found over '''5''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: ec number=EC-2.3.1.42}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200435 25200435]
{{#set: in pathway=PWY-7411}}
+
* CHEBI:
{{#set: reconstruction category=annotation}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47914 47914]
{{#set: reconstruction tool=pathwaytools}}
+
* LIGAND-CPD:
{{#set: reconstruction source=esiliculosus_genome}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C06751 C06751]
 +
* HMDB : HMDB12286
 +
{{#set: smiles=CC(C)=CCSCC([N+])C(=O)[O-]}}
 +
{{#set: inchi key=InChIKey=ULHWZNASVJIOEM-ZETCQYMHSA-N}}
 +
{{#set: common name=S-prenyl-L-cysteine}}
 +
{{#set: molecular weight=189.272    }}
 +
{{#set: common name=prenyl-L-cysteine}}
 +
{{#set: consumed by=1.8.3.5-RXN}}

Latest revision as of 20:35, 21 March 2018

Metabolite S-PRENYL-L-CYSTEINE

  • smiles:
    • CC(C)=CCSCC([N+])C(=O)[O-]
  • inchi key:
    • InChIKey=ULHWZNASVJIOEM-ZETCQYMHSA-N
  • common name:
    • S-prenyl-L-cysteine
  • molecular weight:
    • 189.272
  • Synonym(s):
    • prenyl-L-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCSCC([N+])C(=O)[O-" cannot be used as a page name in this wiki.