Difference between revisions of "Ec-05 006760"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROPHOSPHOGLYCEROL GLYCEROPHOSPHOGLYCEROL] == * smiles: ** C(C(COP(OCC(CO)O)([O-])=O)O)O *...") |
(Created page with "Category:Gene == Gene Ec-05_006760 == * left end position: ** 8838558 * transcription direction: ** NEGATIVE * right end position: ** 8845803 * centisome position: ** 97.0...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-05_006760 == |
− | * | + | * left end position: |
− | ** | + | ** 8838558 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 8845803 |
− | * | + | * centisome position: |
− | ** | + | ** 97.08962 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0153_0045 |
− | ** | + | ** Esi0153_0045 |
+ | ** CBL1 | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[CYSTATHIONINE-BETA-LYASE-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: ec-number |
+ | * Reaction: [[RXN-12729]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-15131]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-15137]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[HOMOSER-METSYN-PWY]] | ||
+ | * [[PWY-801]] | ||
+ | * [[PWY-6936]] | ||
+ | * [[PWY-702]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=8838558}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=8845803}} | |
− | + | {{#set: centisome position=97.08962 }} | |
− | + | {{#set: common name=Esi_0153_0045|Esi0153_0045|CBL1}} | |
− | + | {{#set: reaction associated=CYSTATHIONINE-BETA-LYASE-RXN|RXN-12729|RXN-15131|RXN-15137}} | |
− | + | {{#set: pathway associated=HOMOSER-METSYN-PWY|PWY-801|PWY-6936|PWY-702}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:36, 21 March 2018
Gene Ec-05_006760
- left end position:
- 8838558
- transcription direction:
- NEGATIVE
- right end position:
- 8845803
- centisome position:
- 97.08962
- Synonym(s):
- Esi_0153_0045
- Esi0153_0045
- CBL1
Reactions associated
- Reaction: CYSTATHIONINE-BETA-LYASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN-12729
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN-15131
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN-15137
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome