Difference between revisions of "Ec-20 001950"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4211 CPD-4211] == * smiles: ** CC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-] * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene Ec-20_001950 == * left end position: ** 1928474 * transcription direction: ** NEGATIVE * right end position: ** 1932140 * centisome position: ** 37.3...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-20_001950 == |
− | * | + | * left end position: |
− | ** | + | ** 1928474 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 1932140 |
− | * | + | * centisome position: |
− | ** | + | ** 37.399467 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0023_0101 |
− | ** | + | ** Esi0023_0101 |
− | ** | + | ** GST |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[GSHTRAN-RXN]] |
− | * [[RXN- | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[RXN- | + | *** Assignment: automated-name-match |
− | * [[ | + | * Reaction: [[GST-RXN]] |
− | * [[RXN- | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: automated-name-match |
− | == | + | * Reaction: [[RXN-13673]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | + | *** Assignment: automated-name-match | |
− | * [[ | + | * Reaction: [[RXN-15680]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7112]] | ||
+ | * [[PWY-6842]] | ||
+ | * [[PWY-4061]] | ||
+ | * [[PWY-7533]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1928474}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=1932140}} | |
− | + | {{#set: centisome position=37.399467 }} | |
− | + | {{#set: common name=Esi_0023_0101|Esi0023_0101|GST}} | |
− | + | {{#set: reaction associated=GSHTRAN-RXN|GST-RXN|RXN-13673|RXN-15680}} | |
− | + | {{#set: pathway associated=PWY-7112|PWY-6842|PWY-4061|PWY-7533}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:36, 21 March 2018
Gene Ec-20_001950
- left end position:
- 1928474
- transcription direction:
- NEGATIVE
- right end position:
- 1932140
- centisome position:
- 37.399467
- Synonym(s):
- Esi_0023_0101
- Esi0023_0101
- GST
Reactions associated
- Reaction: GSHTRAN-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: GST-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-13673
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-15680
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome