Difference between revisions of "P105-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14053 CPD-14053] == * smiles: ** CC(O)C(O)[CH]1(CNC2(N=C(N)NC(C(N1)=2)=O)) * common name: *...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P105-PWY P105-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-11...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14053 CPD-14053] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=P105-PWY P105-PWY] ==
−
* smiles:
+
* taxonomic range:
−
** CC(O)C(O)[CH]1(CNC2(N=C(N)NC(C(N1)=2)=O))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3035 TAX-3035]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-201174 TAX-201174]
 
* common name:
 
* common name:
−
** L-erythro-5,6,7,8-tetrahydrobiopterin
+
** TCA cycle IV (2-oxoglutarate decarboxylase)
−
* inchi key:
+
−
** InChIKey=FNKQXYHWGSIFBK-RPDRRWSUSA-N
+
−
* molecular weight:
+
−
** 241.249   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (6R)-5,6,7,8-tetrahydrobiopterin
+
** citric acid cycle
 +
** tricarboxylic acid cycle
 +
** Szent-Gyorgyi-Krebs cycle
 +
** Krebs cycle
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN66-569]]
+
'''9''' reactions found over '''11''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[ACONITATEDEHYDR-RXN]]
−
* [[RXN-8853]]
+
** 2 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-16_001000]]
 +
*** [[Ec-12_000170]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[ACONITATEHYDR-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-16_001000]]
 +
*** [[Ec-12_000170]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[CITSYN-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[FUMHYDR-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-25_001360]]
 +
*** [[Ec-23_003460]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[ISOCIT-CLEAV-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-12_007550]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[ISOCITDEH-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-11_003080]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[MALATE-DEH-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-10_006200]]
 +
*** [[Ec-02_003100]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[MALSYN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-12_003860]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[RXN-14971]]
 +
** 6 associated gene(s):
 +
*** [[Ec-05_003640]]
 +
*** [[Ec-21_003470]]
 +
*** [[Ec-07_002870]]
 +
*** [[Ec-11_000360]]
 +
*** [[Ec-27_006560]]
 +
*** [[Ec-07_007310]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7774 RXN-7774]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=SUCCSEMIALDDEHYDROG-RXN SUCCSEMIALDDEHYDROG-RXN]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-1117}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44257 44257]
+
{{#set: taxonomic range=TAX-3035}}
−
* CHEBI:
+
{{#set: taxonomic range=TAX-1224}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59560 59560]
+
{{#set: taxonomic range=TAX-201174}}
−
* METABOLIGHTS : MTBLC59560
+
{{#set: common name=TCA cycle IV (2-oxoglutarate decarboxylase)}}
−
* HMDB : HMDB00787
+
{{#set: common name=citric acid cycle|tricarboxylic acid cycle|Szent-Gyorgyi-Krebs cycle|Krebs cycle}}
−
{{#set: smiles=CC(O)C(O)[CH]1(CNC2(N=C(N)NC(C(N1)=2)=O))}}
+
{{#set: reaction found=9}}
−
{{#set: common name=L-erythro-5,6,7,8-tetrahydrobiopterin}}
+
{{#set: total reaction=11}}
−
{{#set: inchi key=InChIKey=FNKQXYHWGSIFBK-RPDRRWSUSA-N}}
+
{{#set: completion rate=82.0}}
−
{{#set: molecular weight=241.249    }}
+
−
{{#set: common name=(6R)-5,6,7,8-tetrahydrobiopterin}}
+
−
{{#set: consumed by=RXN66-569}}
+
−
{{#set: produced by=RXN-8853}}
+

Latest revision as of 19:02, 21 March 2018

Pathway P105-PWY

  • taxonomic range:
  • common name:
    • TCA cycle IV (2-oxoglutarate decarboxylase)
  • Synonym(s):
    • citric acid cycle
    • tricarboxylic acid cycle
    • Szent-Gyorgyi-Krebs cycle
    • Krebs cycle

Reaction(s) found

9 reactions found over 11 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=P105-PWY&oldid=24076"