Difference between revisions of "Ec-06 002520"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12853 CPD-12853] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(...")
 
(Created page with "Category:Gene == Gene Ec-06_002520 == * left end position: ** 1827183 * transcription direction: ** POSITIVE * right end position: ** 1827541 * centisome position: ** 20.8...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12853 CPD-12853] ==
+
== Gene Ec-06_002520 ==
−
* smiles:
+
* left end position:
−
** CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
+
** 1827183
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QJVMEAZHJKXWJD-HESBYNJASA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 4α-methyl-5α-cholesta-8,14,24-trien-3β-ol
+
** 1827541
−
* molecular weight:
+
* centisome position:
−
** 396.655    
+
** 20.863592    
 
* Synonym(s):
 
* Synonym(s):
−
** cholesta-8,14,24-trien-3-ol, 4-methyl-, (3β,4α,5α)-
+
** Esi_0384_0026
 +
** Esi0384_0026
 +
** GST
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[GSHTRAN-RXN]]
−
* [[RXN-11881]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[GST-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13673]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15680]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7112]]
 +
* [[PWY-6842]]
 +
* [[PWY-4061]]
 +
* [[PWY-7533]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1827183}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986075 50986075]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}}
+
{{#set: right end position=1827541}}
−
{{#set: inchi key=InChIKey=QJVMEAZHJKXWJD-HESBYNJASA-N}}
+
{{#set: centisome position=20.863592   }}
−
{{#set: common name=4α-methyl-5α-cholesta-8,14,24-trien-3β-ol}}
+
{{#set: common name=Esi_0384_0026|Esi0384_0026|GST}}
−
{{#set: molecular weight=396.655   }}
+
{{#set: reaction associated=GSHTRAN-RXN|GST-RXN|RXN-13673|RXN-15680}}
−
{{#set: common name=cholesta-8,14,24-trien-3-ol, 4-methyl-, (3β,4α,5α)-}}
+
{{#set: pathway associated=PWY-7112|PWY-6842|PWY-4061|PWY-7533}}
−
{{#set: produced by=RXN-11881}}
+

Latest revision as of 19:36, 21 March 2018

Gene Ec-06_002520

  • left end position:
    • 1827183
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1827541
  • centisome position:
    • 20.863592
  • Synonym(s):
    • Esi_0384_0026
    • Esi0384_0026
    • GST

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-06_002520&oldid=28099"