Difference between revisions of "HISTAMINE"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-07_006660 == * left end position: ** 6407130 * transcription direction: ** POSITIVE * right end position: ** 6413630 * centisome position: ** 82.9...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTAMINE HISTAMINE] == * smiles: ** C1(=C(NC=N1)CC[N+]) * inchi key: ** InChIKey=NTYJJOPFIAHUR...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTAMINE HISTAMINE] == |
| − | * | + | * smiles: |
| − | ** | + | ** C1(=C(NC=N1)CC[N+]) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=NTYJJOPFIAHURM-UHFFFAOYSA-O |
| − | * | + | * common name: |
| − | ** | + | ** histamine |
| − | * | + | * molecular weight: |
| − | ** | + | ** 112.154 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** peremin |
| − | ** | + | ** 1H-Imidazole-4-ethanamine |
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[HISTIDINE-DECARBOXYLASE-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 51-45-6 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201573 25201573] |
| − | {{#set: | + | * HMDB : HMDB00870 |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00388 C00388] | |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58432 58432] | ||
| + | * METABOLIGHTS : MTBLC58432 | ||
| + | {{#set: smiles=C1(=C(NC=N1)CC[N+])}} | ||
| + | {{#set: inchi key=InChIKey=NTYJJOPFIAHURM-UHFFFAOYSA-O}} | ||
| + | {{#set: common name=histamine}} | ||
| + | {{#set: molecular weight=112.154 }} | ||
| + | {{#set: common name=peremin|1H-Imidazole-4-ethanamine}} | ||
| + | {{#set: produced by=HISTIDINE-DECARBOXYLASE-RXN}} | ||
Latest revision as of 19:36, 21 March 2018
Contents
Metabolite HISTAMINE
- smiles:
- C1(=C(NC=N1)CC[N+])
- inchi key:
- InChIKey=NTYJJOPFIAHURM-UHFFFAOYSA-O
- common name:
- histamine
- molecular weight:
- 112.154
- Synonym(s):
- peremin
- 1H-Imidazole-4-ethanamine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 51-45-6
- PUBCHEM:
- HMDB : HMDB00870
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC58432
"C1(=C(NC=N1)CC[N+])" cannot be used as a page name in this wiki.
