Difference between revisions of "Ec-25 000140"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-469 CPD-469] == * smiles: ** CC(=O)NC(C([O-])=O)CC[CH]=O * inchi key: ** InChIKey=BCPSFKBPH...") |
(Created page with "Category:Gene == Gene Ec-25_000140 == * left end position: ** 163463 * transcription direction: ** POSITIVE * right end position: ** 172120 * centisome position: ** 3.6725...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-25_000140 == |
− | * | + | * left end position: |
− | ** | + | ** 163463 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 172120 |
− | * | + | * centisome position: |
− | ** | + | ** 3.6725516 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0322_0032 |
− | ** | + | ** Esi0322_0032 |
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[PYRUVDEH-RXN]] | |
− | == | + | ** Source: [[orthology-aragem]] |
− | * [[ | + | ** Source: [[orthology-aragem]] |
− | * [[ | + | * Reaction: [[RXN0-1133]] |
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PYRUVDEHYD-PWY]] | ||
+ | * [[PWY-7218]] | ||
+ | * [[PWY-7384]] | ||
+ | * [[PWY-6886]] | ||
+ | * [[PWY-5537]] | ||
+ | * [[GLYCOLYSIS-TCA-GLYOX-BYPASS]] | ||
+ | * [[PWY-5482]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=163463}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=172120}} | |
− | + | {{#set: centisome position=3.6725516 }} | |
− | + | {{#set: common name=Esi_0322_0032|Esi0322_0032}} | |
− | + | {{#set: reaction associated=PYRUVDEH-RXN|RXN0-1133}} | |
− | + | {{#set: pathway associated=PYRUVDEHYD-PWY|PWY-7218|PWY-7384|PWY-6886|PWY-5537|GLYCOLYSIS-TCA-GLYOX-BYPASS|PWY-5482}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:36, 21 March 2018
Gene Ec-25_000140
- left end position:
- 163463
- transcription direction:
- POSITIVE
- right end position:
- 172120
- centisome position:
- 3.6725516
- Synonym(s):
- Esi_0322_0032
- Esi0322_0032
Reactions associated
- Reaction: PYRUVDEH-RXN
- Source: orthology-aragem
- Source: orthology-aragem
- Reaction: RXN0-1133
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome