Difference between revisions of "DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6382 RXN0-6382] == * direction: ** LEFT-TO-RIGHT * common name: ** inosine triphosphate pyroph...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR] == * smiles: ** C(C2(C(O...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR] == |
− | * | + | * smiles: |
− | ** | + | ** C(C2(C(O)C(O)C(NC1(=C(N)C(=O)NC(=N1)N))O2))OP(=O)([O-])[O-] |
+ | * inchi key: | ||
+ | ** InChIKey=OCLCLRXKNJCOJD-UMMCILCDSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** 2,5-diamino-6-(5-phospho-D-ribosylamino)pyrimidin-4(3H)-one |
− | * | + | * molecular weight: |
− | ** | + | ** 351.212 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 2,5-diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine | ||
+ | ** DARP | ||
+ | ** 2,5-diamino-6-(1-D-ribosylamino)pyrimidin-4(3H)-one 5'-phosphate | ||
+ | ** 2,5-diamino-6-(ribosylamino)-4-(3H)-pyrimidinone 5'-phosphate | ||
+ | ** 2,5-diamino-6-(D-ribosylamino)pyrimidin-4(3H)-one 5'-phosphate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RIBOFLAVINSYNDEAM-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[GTP-CYCLOHYDRO-II-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/ | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244331 25244331] |
− | * LIGAND- | + | * CHEBI: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29114 29114] |
− | {{#set: | + | * BIGG : 1446959 |
− | {{#set: | + | * LIGAND-CPD: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01304 C01304] | |
− | {{#set: | + | {{#set: smiles=C(C2(C(O)C(O)C(NC1(=C(N)C(=O)NC(=N1)N))O2))OP(=O)([O-])[O-]}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=OCLCLRXKNJCOJD-UMMCILCDSA-L}} |
− | {{#set: | + | {{#set: common name=2,5-diamino-6-(5-phospho-D-ribosylamino)pyrimidin-4(3H)-one}} |
− | {{#set: | + | {{#set: molecular weight=351.212 }} |
− | + | {{#set: common name=2,5-diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine|DARP|2,5-diamino-6-(1-D-ribosylamino)pyrimidin-4(3H)-one 5'-phosphate|2,5-diamino-6-(ribosylamino)-4-(3H)-pyrimidinone 5'-phosphate|2,5-diamino-6-(D-ribosylamino)pyrimidin-4(3H)-one 5'-phosphate}} | |
− | {{#set: | + | {{#set: consumed by=RIBOFLAVINSYNDEAM-RXN}} |
− | + | {{#set: produced by=GTP-CYCLOHYDRO-II-RXN}} | |
− | + |
Latest revision as of 19:36, 21 March 2018
Contents
Metabolite DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR
- smiles:
- C(C2(C(O)C(O)C(NC1(=C(N)C(=O)NC(=N1)N))O2))OP(=O)([O-])[O-]
- inchi key:
- InChIKey=OCLCLRXKNJCOJD-UMMCILCDSA-L
- common name:
- 2,5-diamino-6-(5-phospho-D-ribosylamino)pyrimidin-4(3H)-one
- molecular weight:
- 351.212
- Synonym(s):
- 2,5-diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine
- DARP
- 2,5-diamino-6-(1-D-ribosylamino)pyrimidin-4(3H)-one 5'-phosphate
- 2,5-diamino-6-(ribosylamino)-4-(3H)-pyrimidinone 5'-phosphate
- 2,5-diamino-6-(D-ribosylamino)pyrimidin-4(3H)-one 5'-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C2(C(O)C(O)C(NC1(=C(N)C(=O)NC(=N1)N))O2))OP(=O)([O-])[O-" cannot be used as a page name in this wiki.