Difference between revisions of "CPD-709"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R08184 R08184] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With identi...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-709 CPD-709] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2C...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-709 CPD-709] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34)))) |
| + | * inchi key: | ||
| + | ** InChIKey=DDJMOMHMVFXEQF-JBQSTXLYSA-N | ||
| + | * common name: | ||
| + | ** (5α)-campestan-3-one | ||
| + | * molecular weight: | ||
| + | ** 400.687 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** methylcholestanone | ||
| + | ** (24R)-24-methyl-5α-cholestan-3-one | ||
| + | ** 3-dehydro-campestanol | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-711]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * | + | |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201374 25201374] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15786 C15786] |
| + | * HMDB : HMDB12116 | ||
| + | {{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}} | ||
| + | {{#set: inchi key=InChIKey=DDJMOMHMVFXEQF-JBQSTXLYSA-N}} | ||
| + | {{#set: common name=(5α)-campestan-3-one}} | ||
| + | {{#set: molecular weight=400.687 }} | ||
| + | {{#set: common name=methylcholestanone|(24R)-24-methyl-5α-cholestan-3-one|3-dehydro-campestanol}} | ||
| + | {{#set: produced by=RXN-711}} | ||
Latest revision as of 19:36, 21 March 2018
Contents
Metabolite CPD-709
- smiles:
- CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
- inchi key:
- InChIKey=DDJMOMHMVFXEQF-JBQSTXLYSA-N
- common name:
- (5α)-campestan-3-one
- molecular weight:
- 400.687
- Synonym(s):
- methylcholestanone
- (24R)-24-methyl-5α-cholestan-3-one
- 3-dehydro-campestanol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
