Difference between revisions of "RXN-16042"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRYPTAMINE TRYPTAMINE] == * smiles: ** C([N+])CC2(=CNC1(=C(C=CC=C1)2)) * inchi key: ** InChIKey...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16042 RXN-16042] == * direction: ** LEFT-TO-RIGHT * common name: ** Lyso-phosphatidylcholine ac...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16042 RXN-16042] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Lyso-phosphatidylcholine acyltransferase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.3.1.23 EC-2.3.1.23] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[CPD-14394]][c] '''+''' 1 [[Glycerolipids]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[CPD-17281]][c] |
− | == | + | * With common name(s): |
+ | ** 1 (8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl-CoA[c] '''+''' 1 a glycerolipid[c] '''=>''' 1 coenzyme A[c] '''+''' 1 a [glycerolipid]-icosatetraenoate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-16_002160]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PWY-6958]], icosapentaenoate biosynthesis I (lower eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6958 PWY-6958] | ||
+ | ** '''2''' reactions found over '''8''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=Lyso-phosphatidylcholine acyltransferase}} | |
− | + | {{#set: ec number=EC-2.3.1.23}} | |
− | + | {{#set: gene associated=Ec-16_002160}} | |
− | + | {{#set: in pathway=PWY-6958}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:02, 21 March 2018
Contents
Reaction RXN-16042
- direction:
- LEFT-TO-RIGHT
- common name:
- Lyso-phosphatidylcholine acyltransferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD-14394[c] + 1 Glycerolipids[c] => 1 CO-A[c] + 1 CPD-17281[c]
- With common name(s):
- 1 (8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl-CoA[c] + 1 a glycerolipid[c] => 1 coenzyme A[c] + 1 a [glycerolipid]-icosatetraenoate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-16_002160
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
- PWY-6958, icosapentaenoate biosynthesis I (lower eukaryotes): PWY-6958
- 2 reactions found over 8 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome