Difference between revisions of "Ec-15 000670"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-37 CPD-37] == * smiles: ** [CH](=O)C(O)C(O)CC(=O)C(=O)[O-] * inchi key: ** InChIKey=IMUGYKF...") |
(Created page with "Category:Gene == Gene Ec-15_000670 == * left end position: ** 922071 * transcription direction: ** NEGATIVE * right end position: ** 926815 * centisome position: ** 17.080...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-15_000670 == |
− | * | + | * left end position: |
− | ** | + | ** 922071 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 926815 |
− | * | + | * centisome position: |
− | ** | + | ** 17.080915 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0012_0056 |
− | ** | + | ** Esi0012_0056 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[1.1.1.145-RXN]] | |
− | == | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: go-term |
+ | * Reaction: [[RXN-12693]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | * Reaction: [[RXN-12747]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | * Reaction: [[RXN-12789]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6948]] | ||
+ | * [[PWY-6946]] | ||
+ | * [[PWY-6944]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=922071}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=926815}} | |
− | + | {{#set: centisome position=17.080915 }} | |
− | + | {{#set: common name=Esi_0012_0056|Esi0012_0056}} | |
− | + | {{#set: reaction associated=1.1.1.145-RXN|RXN-12693|RXN-12747|RXN-12789}} | |
− | + | {{#set: pathway associated=PWY-6948|PWY-6946|PWY-6944}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:37, 21 March 2018
Gene Ec-15_000670
- left end position:
- 922071
- transcription direction:
- NEGATIVE
- right end position:
- 926815
- centisome position:
- 17.080915
- Synonym(s):
- Esi_0012_0056
- Esi0012_0056
Reactions associated
- Reaction: 1.1.1.145-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-12693
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-12747
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-12789
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome