Difference between revisions of "Ec-15 000670"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-37 CPD-37] == * smiles: ** [CH](=O)C(O)C(O)CC(=O)C(=O)[O-] * inchi key: ** InChIKey=IMUGYKF...")
 
(Created page with "Category:Gene == Gene Ec-15_000670 == * left end position: ** 922071 * transcription direction: ** NEGATIVE * right end position: ** 926815 * centisome position: ** 17.080...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-37 CPD-37] ==
+
== Gene Ec-15_000670 ==
−
* smiles:
+
* left end position:
−
** [CH](=O)C(O)C(O)CC(=O)C(=O)[O-]
+
** 922071
−
* inchi key:
+
* transcription direction:
−
** InChIKey=IMUGYKFHMJLTOU-UCORVYFPSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 5-dehydro-4-deoxy-D-glucuronate
+
** 926815
−
* molecular weight:
+
* centisome position:
−
** 175.118    
+
** 17.080915    
 
* Synonym(s):
 
* Synonym(s):
−
** 4-deoxy-L-threo-5-hexosulose uronate
+
** Esi_0012_0056
−
** 4,5-dihydroxy-2,6-dioxo-hexanoate
+
** Esi0012_0056
−
** (4S,5R)-4,5-dihydroxy-2,6-dioxohexanoate
+
−
** 5-keto-4-deoxyuronate
+
−
** DKI
+
−
** 4-deoxy-5-ketouronic acid
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[1.1.1.145-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-16475]]
+
*** Assignment: go-term
 +
* Reaction: [[RXN-12693]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-12747]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-12789]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-6948]]
 +
* [[PWY-6946]]
 +
* [[PWY-6944]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=922071}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9548606 9548606]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEMSPIDER:
+
{{#set: right end position=926815}}
−
** [http://www.chemspider.com/Chemical-Structure.7827529.html 7827529]
+
{{#set: centisome position=17.080915   }}
−
* CHEBI:
+
{{#set: common name=Esi_0012_0056|Esi0012_0056}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17117 17117]
+
{{#set: reaction associated=1.1.1.145-RXN|RXN-12693|RXN-12747|RXN-12789}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-6948|PWY-6946|PWY-6944}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04053 C04053]
+
−
{{#set: smiles=[CH](=O)C(O)C(O)CC(=O)C(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=IMUGYKFHMJLTOU-UCORVYFPSA-M}}
+
−
{{#set: common name=5-dehydro-4-deoxy-D-glucuronate}}
+
−
{{#set: molecular weight=175.118   }}
+
−
{{#set: common name=4-deoxy-L-threo-5-hexosulose uronate|4,5-dihydroxy-2,6-dioxo-hexanoate|(4S,5R)-4,5-dihydroxy-2,6-dioxohexanoate|5-keto-4-deoxyuronate|DKI|4-deoxy-5-ketouronic acid}}
+
−
{{#set: consumed or produced by=RXN-16475}}
+

Latest revision as of 19:37, 21 March 2018

Gene Ec-15_000670

  • left end position:
    • 922071
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 926815
  • centisome position:
    • 17.080915
  • Synonym(s):
    • Esi_0012_0056
    • Esi0012_0056

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-15_000670&oldid=28170"