Difference between revisions of "Ec-04 003730"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SCOPOLETIN SCOPOLETIN] == * smiles: ** COC2(C=C1(C(OC(=O)C=C1)=CC=2O)) * inchi key: ** InChIKey...") |
(Created page with "Category:Gene == Gene Ec-04_003730 == * left end position: ** 3812194 * transcription direction: ** NEGATIVE * right end position: ** 3820426 * centisome position: ** 58.5...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-04_003730 == |
− | * | + | * left end position: |
− | ** | + | ** 3812194 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 3820426 |
− | * | + | * centisome position: |
− | ** | + | ** 58.5424 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0080_0009 | ||
+ | ** Esi0080_0009 | ||
+ | ** GanAB | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[3.2.1.84-RXN]] | |
− | * [[RXN- | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: ec-number |
+ | * Reaction: [[ALPHAGALACTOSID-RXN]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Reaction: [[RXN-15910]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-842]] | ||
+ | * [[PWY0-1301]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3812194}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=3820426}} | |
− | + | {{#set: centisome position=58.5424 }} | |
− | + | {{#set: common name=Esi_0080_0009|Esi0080_0009|GanAB}} | |
− | + | {{#set: reaction associated=3.2.1.84-RXN|ALPHAGALACTOSID-RXN|RXN-15910}} | |
− | + | {{#set: pathway associated=PWY-842|PWY0-1301}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:37, 21 March 2018
Gene Ec-04_003730
- left end position:
- 3812194
- transcription direction:
- NEGATIVE
- right end position:
- 3820426
- centisome position:
- 58.5424
- Synonym(s):
- Esi_0080_0009
- Esi0080_0009
- GanAB
Reactions associated
- Reaction: 3.2.1.84-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: ALPHAGALACTOSID-RXN
- Source: orthology-aragem
- Reaction: RXN-15910
- Source: orthology-aragem
- Source: orthology-aragem