Difference between revisions of "Ec-27 005300"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14704 CPD-14704] == * smiles: ** CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([...")
 
(Created page with "Category:Gene == Gene Ec-27_005300 == * left end position: ** 4789968 * transcription direction: ** POSITIVE * right end position: ** 4798451 * centisome position: ** 74.2...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14704 CPD-14704] ==
+
== Gene Ec-27_005300 ==
−
* smiles:
+
* left end position:
−
** CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O
+
** 4789968
−
* inchi key:
+
* transcription direction:
−
** InChIKey=NOKRNJLENDLSKM-UHFFFAOYSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 4-hydroxy-2-nonenal-glutathione conjugate
+
** 4798451
−
* molecular weight:
+
* centisome position:
−
** 462.537    
+
** 74.26414    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0000_0231
 +
** Esi0000_0231
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[2.7.10.1-RXN]]
−
* [[RXN-13673]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4789968}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657725 90657725]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O}}
+
{{#set: right end position=4798451}}
−
{{#set: inchi key=InChIKey=NOKRNJLENDLSKM-UHFFFAOYSA-M}}
+
{{#set: centisome position=74.26414    }}
−
{{#set: common name=4-hydroxy-2-nonenal-glutathione conjugate}}
+
{{#set: common name=Esi_0000_0231|Esi0000_0231}}
−
{{#set: molecular weight=462.537    }}
+
{{#set: reaction associated=2.7.10.1-RXN}}
−
{{#set: produced by=RXN-13673}}
+

Latest revision as of 19:37, 21 March 2018

Gene Ec-27_005300

  • left end position:
    • 4789968
  • transcription direction:
    • POSITIVE
  • right end position:
    • 4798451
  • centisome position:
    • 74.26414
  • Synonym(s):
    • Esi_0000_0231
    • Esi0000_0231

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-27_005300&oldid=28207"