Difference between revisions of "RXN-13697"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-479 CPD-479] == * smiles: ** CSCCC(C([O-])=O)=O * inchi key: ** InChIKey=SXFSQZDSUWACKX-UHF...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13697 RXN-13697] == * direction: ** REVERSIBLE * common name: ** Aspartate Aminotransferase **...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-479 CPD-479] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13697 RXN-13697] ==
−
* smiles:
+
* direction:
−
** CSCCC(C([O-])=O)=O
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=SXFSQZDSUWACKX-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** 2-oxo-4-methylthiobutanoate
+
** Aspartate Aminotransferase
−
* molecular weight:
+
** Pyridoxal phosphate-dependent transferase, major region, subdomain 1
−
** 147.168   
+
** aspartate aminotransferase
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.6.1.1 EC-2.6.1.1]
 
* Synonym(s):
 
* Synonym(s):
−
** 2-keto-methyl-thio-butyrate
 
−
** 2-keto-4-methylthiobutyrate
 
−
** 4-methylthio-2-oxobutanoate
 
−
** α-keto-4-methylthiobutyrate
 
−
** 4-methylthio-2-ketobutyrate
 
−
** 4-methylthio-2-ketobutanoate
 
−
** 4-methylthio-2-oxobutyrate
 
−
** 2-ketomethiobutyrate
 
−
** KMTB
 
−
** α-ketomethiobutyrate
 
−
** 2-keto-4-methylthiobutyric acid
 
−
** α-ketomethiobutyric acid
 
−
** α-keto-γ-methylthiobutyrate
 
−
** α-keto-γ-methylthiobutyric acid
 
−
** 2-oxo-4-methylthiobutanoic acid
 
−
** 2-oxomethionine
 
−
** 2-keto-4-methylthiobutanoate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-12539]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[L-ASPARTATE]][c] '''+''' 1 [[2-KETOGLUTARATE]][c] '''<=>''' 1 [[GLT]][c] '''+''' 1 [[OXALACETIC_ACID]][c]
−
* [[R15-RXN-MET/P-HYDROXY-PHENYLPYRUVATE//CPD-479/TYR.42.]]
+
* With common name(s):
−
* [[R147-RXN]]
+
** 1 L-aspartate[c] '''+''' 1 2-oxoglutarate[c] '''<=>''' 1 L-glutamate[c] '''+''' 1 oxaloacetate[c]
−
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-01_007480]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-23_003500]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-03_003270]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7117]], C4 photosynthetic carbon assimilation cycle, PEPCK type: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7117 PWY-7117]
 +
** '''9''' reactions found over '''10''' reactions in the full pathway
 +
* [[PWY-7115]], C4 photosynthetic carbon assimilation cycle, NAD-ME type: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7115 PWY-7115]
 +
** '''9''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* BIGG : 228408
+
{{#set: direction=REVERSIBLE}}
−
* PUBCHEM:
+
{{#set: common name=Aspartate Aminotransferase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4584184 4584184]
+
{{#set: common name=Pyridoxal phosphate-dependent transferase, major region, subdomain 1}}
−
* HMDB : HMDB01553
+
{{#set: common name=aspartate aminotransferase}}
−
* LIGAND-CPD:
+
{{#set: ec number=EC-2.6.1.1}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01180 C01180]
+
{{#set: gene associated=Ec-01_007480|Ec-23_003500|Ec-03_003270}}
−
* CHEMSPIDER:
+
{{#set: in pathway=PWY-7117|PWY-7115}}
−
** [http://www.chemspider.com/Chemical-Structure.3776616.html 3776616]
+
{{#set: reconstruction category=annotation}}
−
* CHEBI:
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16723 16723]
+
{{#set: reconstruction tool=pathwaytools}}
−
* METABOLIGHTS : MTBLC16723
+
−
{{#set: smiles=CSCCC(C([O-])=O)=O}}
+
−
{{#set: inchi key=InChIKey=SXFSQZDSUWACKX-UHFFFAOYSA-M}}
+
−
{{#set: common name=2-oxo-4-methylthiobutanoate}}
+
−
{{#set: molecular weight=147.168    }}
+
−
{{#set: common name=2-keto-methyl-thio-butyrate|2-keto-4-methylthiobutyrate|4-methylthio-2-oxobutanoate|&alpha;-keto-4-methylthiobutyrate|4-methylthio-2-ketobutyrate|4-methylthio-2-ketobutanoate|4-methylthio-2-oxobutyrate|2-ketomethiobutyrate|KMTB|&alpha;-ketomethiobutyrate|2-keto-4-methylthiobutyric acid|&alpha;-ketomethiobutyric acid|&alpha;-keto-&gamma;-methylthiobutyrate|&alpha;-keto-&gamma;-methylthiobutyric acid|2-oxo-4-methylthiobutanoic acid|2-oxomethionine|2-keto-4-methylthiobutanoate}}
+
−
{{#set: consumed by=RXN-12539}}
+
−
{{#set: produced by=R15-RXN-MET/P-HYDROXY-PHENYLPYRUVATE//CPD-479/TYR.42.|R147-RXN}}
+

Latest revision as of 19:37, 21 March 2018

Reaction RXN-13697

  • direction:
    • REVERSIBLE
  • common name:
    • Aspartate Aminotransferase
    • Pyridoxal phosphate-dependent transferase, major region, subdomain 1
    • aspartate aminotransferase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7117, C4 photosynthetic carbon assimilation cycle, PEPCK type: PWY-7117
    • 9 reactions found over 10 reactions in the full pathway
  • PWY-7115, C4 photosynthetic carbon assimilation cycle, NAD-ME type: PWY-7115
    • 9 reactions found over 9 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-13697&oldid=28228"