Difference between revisions of "Aryl-Alcohol"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-236 CPD-236] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Aryl-Alcohol Aryl-Alcohol] == * common name: ** a phenol * Synonym(s): ** an aromatic alcohol *...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-236 CPD-236] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Aryl-Alcohol Aryl-Alcohol] ==
* smiles:
+
** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))
+
* inchi key:
+
** InChIKey=BKBYHSYZKIAJDA-LPEMZMRWSA-M
+
 
* common name:
 
* common name:
** gibberellin A29
+
** a phenol
* molecular weight:
+
** 347.387   
+
 
* Synonym(s):
 
* Synonym(s):
** GA29
+
** an aromatic alcohol
 +
** aryl alcohol
 +
** an aryl alcohol
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-113]]
+
* [[ARYLSULFAT-RXN]]
 +
* [[ARYLDIALKYLPHOSPHATASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[ARYL-SULFOTRANSFERASE-RXN]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a phenol}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200412 25200412]
+
{{#set: common name=an aromatic alcohol|aryl alcohol|an aryl alcohol}}
* CHEBI:
+
{{#set: produced by=ARYLSULFAT-RXN|ARYLDIALKYLPHOSPHATASE-RXN}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28040 28040]
+
{{#set: reversible reaction associated=ARYL-SULFOTRANSFERASE-RXN}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C06096 C06096]
+
{{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
+
{{#set: inchi key=InChIKey=BKBYHSYZKIAJDA-LPEMZMRWSA-M}}
+
{{#set: common name=gibberellin A29}}
+
{{#set: molecular weight=347.387    }}
+
{{#set: common name=GA29}}
+
{{#set: produced by=RXN-113}}
+

Latest revision as of 19:37, 21 March 2018

Metabolite Aryl-Alcohol

  • common name:
    • a phenol
  • Synonym(s):
    • an aromatic alcohol
    • aryl alcohol
    • an aryl alcohol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links