Difference between revisions of "RXN66-146"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-7-DIMETHYLXANTHINE 1-7-DIMETHYLXANTHINE] == * smiles: ** CN2(C=NC1(=C(C(N(C(N1)=O)C)=O)2)) *...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-146 RXN66-146] == * direction: ** LEFT-TO-RIGHT * common name: ** Aromatic-ring hydroxylase-l...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-7-DIMETHYLXANTHINE 1-7-DIMETHYLXANTHINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-146 RXN66-146] ==
−
* smiles:
+
* direction:
−
** CN2(C=NC1(=C(C(N(C(N1)=O)C)=O)2))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=QUNWUDVFRNGTCO-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** paraxanthine
+
** Aromatic-ring hydroxylase-like
−
* molecular weight:
+
** Monooxygenase, FAD-binding
−
** 180.166   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.14.14.1 EC-1.14.14.1]
 
* Synonym(s):
 
* Synonym(s):
−
** 1,7-dimethylxanthine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-11520]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[Red-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[NICOTINE]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[CPD-3187]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[Ox-NADPH-Hemoprotein-Reductases]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a reduced [NADPH-hemoprotein reductase][c] '''+''' 1 (S)-nicotine[c] '''+''' 1 oxygen[c] '''=>''' 1 2'-hydroxynicotine[c] '''+''' 1 H2O[c] '''+''' 1 an oxidized [NADPH-hemoprotein reductase][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-01_010880]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-26_003280]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-00_001320]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY66-201]], nicotine degradation IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-201 PWY66-201]
 +
** '''2''' reactions found over '''17''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4687 4687]
+
{{#set: common name=Aromatic-ring hydroxylase-like}}
−
* HMDB : HMDB01860
+
{{#set: common name=Monooxygenase, FAD-binding}}
−
* LIGAND-CPD:
+
{{#set: ec number=EC-1.14.14.1}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C13747 C13747]
+
{{#set: gene associated=Ec-01_010880|Ec-26_003280|Ec-00_001320}}
−
* CHEMSPIDER:
+
{{#set: in pathway=PWY66-201}}
−
** [http://www.chemspider.com/Chemical-Structure.4525.html 4525]
+
{{#set: reconstruction category=annotation}}
−
* CHEBI:
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=25858 25858]
+
{{#set: reconstruction tool=pathwaytools}}
−
* METABOLIGHTS : MTBLC25858
+
−
{{#set: smiles=CN2(C=NC1(=C(C(N(C(N1)=O)C)=O)2))}}
+
−
{{#set: inchi key=InChIKey=QUNWUDVFRNGTCO-UHFFFAOYSA-N}}
+
−
{{#set: common name=paraxanthine}}
+
−
{{#set: molecular weight=180.166    }}
+
−
{{#set: common name=1,7-dimethylxanthine}}
+
−
{{#set: consumed by=RXN-11520}}
+

Latest revision as of 19:37, 21 March 2018

Reaction RXN66-146

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Aromatic-ring hydroxylase-like
    • Monooxygenase, FAD-binding
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY66-201, nicotine degradation IV: PWY66-201
    • 2 reactions found over 17 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN66-146&oldid=28263"