Difference between revisions of "Ec-28 003630"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE TREHALOSE] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))O * inchi ke...") |
(Created page with "Category:Gene == Gene Ec-28_003630 == * Synonym(s): ** Esi_0009_0037 ** Esi0009_0037 == Reactions associated == * Reaction: ATPASE-RXN ** Source: orthology-aragem...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-28_003630 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0009_0037 |
− | ** | + | ** Esi0009_0037 |
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[ATPASE-RXN]] |
− | + | ** Source: [[orthology-aragem]] | |
− | * [[ | + | == Pathways associated == |
− | == | + | |
== External links == | == External links == | ||
− | + | {{#set: common name=Esi_0009_0037|Esi0009_0037}} | |
− | + | {{#set: reaction associated=ATPASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Latest revision as of 19:37, 21 March 2018
Gene Ec-28_003630
- Synonym(s):
- Esi_0009_0037
- Esi0009_0037
Reactions associated
- Reaction: ATPASE-RXN
- Source: orthology-aragem