Difference between revisions of "RXN-7645"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3187 CPD-3187] == * smiles: ** C1(CCC(O)([N+](C)1)C2(=CN=CC=C2)) * inchi key: ** InChIKey=B...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7645 RXN-7645] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7645 RXN-7645] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | * ec number: | |
| − | + | ** [http://enzyme.expasy.org/EC/2.3.1 EC-2.3.1] | |
| − | * | + | |
| − | ** 2 | + | |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | == | + | * With identifiers: |
| − | * [[ | + | ** 3 [[MALONYL-COA]][c] '''+''' 3 [[PROTON]][c] '''+''' 1 [[CINNAMOYL-COA]][c] '''=>''' 4 [[CO-A]][c] '''+''' 1 [[CPD-6993]][c] '''+''' 3 [[CARBON-DIOXIDE]][c] |
| − | == | + | * With common name(s): |
| + | ** 3 malonyl-CoA[c] '''+''' 3 H+[c] '''+''' 1 (E)-cinnamoyl-CoA[c] '''=>''' 4 coenzyme A[c] '''+''' 1 pinocembrin chalcone[c] '''+''' 3 CO2[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Ec-02_004580]] | ||
| + | ** Source: [[orthology-aragem]] | ||
| + | * Gene: [[Ec-07_006660]] | ||
| + | ** Source: [[orthology-aragem]] | ||
| + | * Gene: [[Ec-07_003670]] | ||
| + | ** Source: [[orthology-aragem]] | ||
| + | == Pathways == | ||
| + | * [[PWY-5059]], pinobanksin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5059 PWY-5059] | ||
| + | ** '''3''' reactions found over '''4''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-aragem]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | * | + | * LIGAND-RXN: |
| − | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R07987 R07987] |
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | {{#set: | + | {{#set: ec number=EC-2.3.1}} |
| − | {{#set: | + | {{#set: gene associated=Ec-02_004580|Ec-07_006660|Ec-07_003670}} |
| − | {{#set: | + | {{#set: in pathway=PWY-5059}} |
| − | {{#set: | + | {{#set: reconstruction category=orthology}} |
| − | {{#set: | + | {{#set: reconstruction source=orthology-aragem}} |
| + | {{#set: reconstruction tool=pantograph}} | ||
Latest revision as of 19:37, 21 March 2018
Contents
Reaction RXN-7645
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 3 MALONYL-COA[c] + 3 PROTON[c] + 1 CINNAMOYL-COA[c] => 4 CO-A[c] + 1 CPD-6993[c] + 3 CARBON-DIOXIDE[c]
- With common name(s):
- 3 malonyl-CoA[c] + 3 H+[c] + 1 (E)-cinnamoyl-CoA[c] => 4 coenzyme A[c] + 1 pinocembrin chalcone[c] + 3 CO2[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-02_004580
- Source: orthology-aragem
- Gene: Ec-07_006660
- Source: orthology-aragem
- Gene: Ec-07_003670
- Source: orthology-aragem
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
External links
- LIGAND-RXN:
