Difference between revisions of "CPD-7003"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-00_006580 == * left end position: ** 10455943 * transcription direction: ** POSITIVE * right end position: ** 10458685 * centisome position: ** 55...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7003 CPD-7003] == * smiles: ** CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C *...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-00_006580 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7003 CPD-7003] ==
−
* left end position:
+
* smiles:
−
** 10455943
+
** CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K
−
* right end position:
+
* common name:
−
** 10458685
+
** tetrahydrogeranylgeranyl diphosphate
−
* centisome position:
+
* molecular weight:
−
** 55.186874    
+
** 451.456    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0509_0009
+
** tetrahydroGGPP
−
** Esi0509_0009
+
** tetrahydrogeranylgeranyl pyrophosphate
−
** GPX
+
** tetrahydrogeranylgeranyl-PP
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[GLUTATHIONE-PEROXIDASE-RXN]]
+
* [[RXN-7660]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
* [[RXN-7659]]
−
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
−
* [[DETOX1-PWY-1]]
+
−
* [[PWY-4081]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=10455943}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657275 90657275]
−
{{#set: right end position=10458685}}
+
{{#set: smiles=CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C}}
−
{{#set: centisome position=55.186874   }}
+
{{#set: inchi key=InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K}}
−
{{#set: common name=Esi_0509_0009|Esi0509_0009|GPX}}
+
{{#set: common name=tetrahydrogeranylgeranyl diphosphate}}
−
{{#set: reaction associated=GLUTATHIONE-PEROXIDASE-RXN}}
+
{{#set: molecular weight=451.456   }}
−
{{#set: pathway associated=DETOX1-PWY-1|PWY-4081}}
+
{{#set: common name=tetrahydroGGPP|tetrahydrogeranylgeranyl pyrophosphate|tetrahydrogeranylgeranyl-PP}}
 +
{{#set: consumed by=RXN-7660}}
 +
{{#set: produced by=RXN-7659}}

Latest revision as of 20:37, 21 March 2018

Metabolite CPD-7003

  • smiles:
    • CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
  • inchi key:
    • InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K
  • common name:
    • tetrahydrogeranylgeranyl diphosphate
  • molecular weight:
    • 451.456
  • Synonym(s):
    • tetrahydroGGPP
    • tetrahydrogeranylgeranyl pyrophosphate
    • tetrahydrogeranylgeranyl-PP

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-7003&oldid=28288"