Difference between revisions of "Ec-19 004010"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8291 CPD-8291] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP(OCC[N+]...")
 
(Created page with "Category:Gene == Gene Ec-19_004010 == * left end position: ** 4354332 * transcription direction: ** NEGATIVE * right end position: ** 4366157 * centisome position: ** 72.9...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8291 CPD-8291] ==
+
== Gene Ec-19_004010 ==
−
* smiles:
+
* left end position:
−
** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP(OCC[N+])([O-])=O)=O
+
** 4354332
−
* inchi key:
+
* transcription direction:
−
** InChIKey=MWRBNPKJOOWZPW-NYVOMTAGSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 1-18:1-2-18:1-phosphatidylethanolamine
+
** 4366157
−
* molecular weight:
+
* centisome position:
−
** 744.043    
+
** 72.92848    
 
* Synonym(s):
 
* Synonym(s):
−
** phosphatidylethanolamine (1-18:1-2-18:1)
+
** Esi_0088_0081
−
** 18:1-18:1-PE
+
** Esi0088_0081
−
** 1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine
+
** NADPH oxidase
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-15067]]
+
* Reaction: [[RXN-10745]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
−
* [[RXN-15036]]
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4354332}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44251425 44251425]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=4366157}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74986 74986]
+
{{#set: centisome position=72.92848   }}
−
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP(OCC[N+])([O-])=O)=O}}
+
{{#set: common name=Esi_0088_0081|Esi0088_0081|NADPH oxidase}}
−
{{#set: inchi key=InChIKey=MWRBNPKJOOWZPW-NYVOMTAGSA-N}}
+
{{#set: reaction associated=RXN-10745}}
−
{{#set: common name=1-18:1-2-18:1-phosphatidylethanolamine}}
+
−
{{#set: molecular weight=744.043   }}
+
−
{{#set: common name=phosphatidylethanolamine (1-18:1-2-18:1)|18:1-18:1-PE|1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine}}
+
−
{{#set: consumed by=RXN-15067}}
+
−
{{#set: consumed or produced by=RXN-15036}}
+

Latest revision as of 20:38, 21 March 2018

Gene Ec-19_004010

  • left end position:
    • 4354332
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 4366157
  • centisome position:
    • 72.92848
  • Synonym(s):
    • Esi_0088_0081
    • Esi0088_0081
    • NADPH oxidase

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-19_004010&oldid=28325"