Difference between revisions of "CPD-2743"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-804 CPD-804] == * smiles: ** C(CCC(O)CC(C([O-])=O)=O)([O-])=O * inchi key: ** InChIKey=HNOA...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2743 CPD-2743] == * smiles: ** C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2)) * inchi key: ** InChIKey=...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2743 CPD-2743] == |
* smiles: | * smiles: | ||
− | ** | + | ** C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2)) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=RWFBQHICRCUQJJ-NUHJPDEHSA-N |
* common name: | * common name: | ||
− | ** | + | ** nicotine-1'-N-oxide |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 178.233 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** nicotine N'-oxide |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN66-81]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=68107 68107] |
* CHEMSPIDER: | * CHEMSPIDER: | ||
− | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.61415.html 61415] |
− | * | + | * HMDB : HMDB01497 |
− | + | {{#set: smiles=C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2))}} | |
− | + | {{#set: inchi key=InChIKey=RWFBQHICRCUQJJ-NUHJPDEHSA-N}} | |
− | + | {{#set: common name=nicotine-1'-N-oxide}} | |
− | {{#set: smiles= | + | {{#set: molecular weight=178.233 }} |
− | {{#set: inchi key=InChIKey= | + | {{#set: common name=nicotine N'-oxide}} |
− | {{#set: common name= | + | {{#set: produced by=RXN66-81}} |
− | {{#set: molecular weight= | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:38, 21 March 2018
Contents
Metabolite CPD-2743
- smiles:
- C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2))
- inchi key:
- InChIKey=RWFBQHICRCUQJJ-NUHJPDEHSA-N
- common name:
- nicotine-1'-N-oxide
- molecular weight:
- 178.233
- Synonym(s):
- nicotine N'-oxide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2))" cannot be used as a page name in this wiki.