Difference between revisions of "2-3-CARBOXY-3-AMINOPROPYL-L-HISTIDINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-482 CPD-482] == * smiles: ** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-3-CARBOXY-3-AMINOPROPYL-L-HISTIDINE 2-3-CARBOXY-3-AMINOPROPYL-L-HISTIDINE] == * common name:...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-482 CPD-482] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-3-CARBOXY-3-AMINOPROPYL-L-HISTIDINE 2-3-CARBOXY-3-AMINOPROPYL-L-HISTIDINE] ==
−
* smiles:
+
−
** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))
+
−
* inchi key:
+
−
** InChIKey=HHDWSDSMWJQURA-GBNXXHSSSA-M
+
 
* common name:
 
* common name:
−
** gibberellin A51
+
** a 2-[(3S)-3-amino-3-carboxypropyl]-L-histidine-[translation elongation factor 2]
−
* molecular weight:
+
−
** 331.388   
+
 
* Synonym(s):
 
* Synonym(s):
−
** GA51
+
** diphthine intermediate in eEF-2
 +
** a 2-(3-carboxy-3-aminopropyl)-L-histidine in eEF-2
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14326]]
 +
* [[RXN-11370]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-171]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMPR0104170022
+
{{#set: common name=a 2-[(3S)-3-amino-3-carboxypropyl]-L-histidine-[translation elongation factor 2]}}
−
* PUBCHEM:
+
{{#set: common name=diphthine intermediate in eEF-2|a 2-(3-carboxy-3-aminopropyl)-L-histidine in eEF-2}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245666 25245666]
+
{{#set: consumed by=RXN-14326|RXN-11370}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29599 29599]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C11865 C11865]
+
−
* HMDB : HMDB35041
+
−
{{#set: smiles=C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
+
−
{{#set: inchi key=InChIKey=HHDWSDSMWJQURA-GBNXXHSSSA-M}}
+
−
{{#set: common name=gibberellin A51}}
+
−
{{#set: molecular weight=331.388    }}
+
−
{{#set: common name=GA51}}
+
−
{{#set: produced by=RXN-171}}
+

Latest revision as of 18:59, 21 March 2018

Metabolite 2-3-CARBOXY-3-AMINOPROPYL-L-HISTIDINE

  • common name:
    • a 2-[(3S)-3-amino-3-carboxypropyl]-L-histidine-[translation elongation factor 2]
  • Synonym(s):
    • diphthine intermediate in eEF-2
    • a 2-(3-carboxy-3-aminopropyl)-L-histidine in eEF-2

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a 2-[(3S)-3-amino-3-carboxypropyl]-L-histidine-[translation elongation factor 2" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=2-3-CARBOXY-3-AMINOPROPYL-L-HISTIDINE&oldid=23677"