Difference between revisions of "PWY-5532"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4618 CPD-4618] == * smiles: ** CC(=CCNC1(C2(=C(N=CN=1)N=CN2C3(C(C(C(C(O3)CO)O)O)O))))CO * i...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5532 PWY-5532] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5532 PWY-5532] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** nucleoside and nucleotide degradation (archaea) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | == Reaction(s) | + | '''2''' reactions found over '''10''' reactions in the full pathway |
| − | * [[RXN- | + | * [[CYTIKIN-RXN]] |
| − | == | + | ** 0 associated gene: |
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Ec-12_007560]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=ADENPHOSPHOR-RXN ADENPHOSPHOR-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14699 RXN-14699] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14700 RXN-14700] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17337 RXN-17337] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8800 RXN-8800] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8801 RXN-8801] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5199 RXN0-5199] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=URPHOS-RXN URPHOS-RXN] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2157}} | |
| − | + | {{#set: common name=nucleoside and nucleotide degradation (archaea)}} | |
| − | + | {{#set: reaction found=2}} | |
| − | {{#set: | + | {{#set: total reaction=10}} |
| − | {{#set: | + | {{#set: completion rate=20.0}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:02, 21 March 2018
Pathway PWY-5532
- taxonomic range:
- common name:
- nucleoside and nucleotide degradation (archaea)
- Synonym(s):
Reaction(s) found
2 reactions found over 10 reactions in the full pathway
- CYTIKIN-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
