Difference between revisions of "Ec-20 002080"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] == * smiles: ** C(=O)(C1(O)(C=CCCC(=O)1))[O-] * inchi key: ** InChIKey=WEZ...") |
(Created page with "Category:Gene == Gene Ec-20_002080 == * left end position: ** 2075394 * transcription direction: ** POSITIVE * right end position: ** 2090859 * centisome position: ** 40.2...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-20_002080 == |
− | * | + | * left end position: |
− | ** | + | ** 2075394 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2090859 |
− | * | + | * centisome position: |
− | ** | + | ** 40.24873 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0023_0133 |
− | ** | + | ** Esi0023_0133 |
+ | ** PK | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[PROTEIN-KINASE-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2075394}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | {{#set: | + | {{#set: right end position=2090859}} |
− | {{#set: | + | {{#set: centisome position=40.24873 }} |
− | {{#set: | + | {{#set: common name=Esi_0023_0133|Esi0023_0133|PK}} |
− | {{#set: | + | {{#set: reaction associated=PROTEIN-KINASE-RXN}} |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:38, 21 March 2018
Gene Ec-20_002080
- left end position:
- 2075394
- transcription direction:
- POSITIVE
- right end position:
- 2090859
- centisome position:
- 40.24873
- Synonym(s):
- Esi_0023_0133
- Esi0023_0133
- PK
Reactions associated
- Reaction: PROTEIN-KINASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome