Difference between revisions of "Ec-20 002080"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] == * smiles: ** C(=O)(C1(O)(C=CCCC(=O)1))[O-] * inchi key: ** InChIKey=WEZ...")
 
(Created page with "Category:Gene == Gene Ec-20_002080 == * left end position: ** 2075394 * transcription direction: ** POSITIVE * right end position: ** 2090859 * centisome position: ** 40.2...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] ==
+
== Gene Ec-20_002080 ==
−
* smiles:
+
* left end position:
−
** C(=O)(C1(O)(C=CCCC(=O)1))[O-]
+
** 2075394
−
* inchi key:
+
* transcription direction:
−
** InChIKey=WEZWWZKUBQCMBL-UHFFFAOYSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 6-hydroxy-2-cyclohexen-one-carboxylate
+
** 2090859
−
* molecular weight:
+
* centisome position:
−
** 155.13    
+
** 40.24873    
 
* Synonym(s):
 
* Synonym(s):
−
** 6-hydroxy-2-cyclohexen-one-carboxylic acid
+
** Esi_0023_0133
−
** HCC
+
** Esi0023_0133
 +
** PK
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PROTEIN-KINASE-RXN]]
−
* [[RXN-12252]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2075394}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940166 52940166]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=C(=O)(C1(O)(C=CCCC(=O)1))[O-]}}
+
{{#set: right end position=2090859}}
−
{{#set: inchi key=InChIKey=WEZWWZKUBQCMBL-UHFFFAOYSA-M}}
+
{{#set: centisome position=40.24873   }}
−
{{#set: common name=6-hydroxy-2-cyclohexen-one-carboxylate}}
+
{{#set: common name=Esi_0023_0133|Esi0023_0133|PK}}
−
{{#set: molecular weight=155.13   }}
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
−
{{#set: common name=6-hydroxy-2-cyclohexen-one-carboxylic acid|HCC}}
+
−
{{#set: produced by=RXN-12252}}
+

Latest revision as of 19:38, 21 March 2018

Gene Ec-20_002080

  • left end position:
    • 2075394
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2090859
  • centisome position:
    • 40.24873
  • Synonym(s):
    • Esi_0023_0133
    • Esi0023_0133
    • PK

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-20_002080&oldid=28345"