Difference between revisions of "ALPHA-METHYL-5-ALPHA-ERGOSTA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-behenoyl-ACPs 3-oxo-behenoyl-ACPs] == * common name: ** a 3-oxo-behenoyl-[acp] * Synonym(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-METHYL-5-ALPHA-ERGOSTA ALPHA-METHYL-5-ALPHA-ERGOSTA] == * smiles: ** CC(C)C(=C)CCC(C)[CH]...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-METHYL-5-ALPHA-ERGOSTA ALPHA-METHYL-5-ALPHA-ERGOSTA] == |
+ | * smiles: | ||
+ | ** CC(C)C(=C)CCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34)))) | ||
+ | * inchi key: | ||
+ | ** InChIKey=HLAWVOWADPNAGN-BAHZUFOISA-N | ||
* common name: | * common name: | ||
− | ** | + | ** 4α-methyl-5α-ergosta-8,14,24(28)-trien-3β-ol |
+ | * molecular weight: | ||
+ | ** 410.682 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 4α-methyl-5α-ergosta-8,14,24(241)-trien-3β-ol |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-4144]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[1.14.13.70-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203414 25203414] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30109 30109] |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C11508 C11508] | ||
+ | * HMDB : HMDB06928 | ||
+ | {{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}} | ||
+ | {{#set: inchi key=InChIKey=HLAWVOWADPNAGN-BAHZUFOISA-N}} | ||
+ | {{#set: common name=4α-methyl-5α-ergosta-8,14,24(28)-trien-3β-ol}} | ||
+ | {{#set: molecular weight=410.682 }} | ||
+ | {{#set: common name=4α-methyl-5α-ergosta-8,14,24(241)-trien-3β-ol}} | ||
+ | {{#set: consumed by=RXN-4144}} | ||
+ | {{#set: produced by=1.14.13.70-RXN}} |
Latest revision as of 19:38, 21 March 2018
Contents
Metabolite ALPHA-METHYL-5-ALPHA-ERGOSTA
- smiles:
- CC(C)C(=C)CCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
- inchi key:
- InChIKey=HLAWVOWADPNAGN-BAHZUFOISA-N
- common name:
- 4α-methyl-5α-ergosta-8,14,24(28)-trien-3β-ol
- molecular weight:
- 410.682
- Synonym(s):
- 4α-methyl-5α-ergosta-8,14,24(241)-trien-3β-ol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(=C)CCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.