Difference between revisions of "Ec-09 000720"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DEHYDRO-ASCORBATE L-DEHYDRO-ASCORBATE] == * smiles: ** C(O)C(O)C1(C(=O)C(=O)C(=O)O1) * inchi...") |
(Created page with "Category:Gene == Gene Ec-09_000720 == * left end position: ** 933555 * transcription direction: ** NEGATIVE * right end position: ** 950451 * centisome position: ** 16.631...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-09_000720 == |
− | * | + | * left end position: |
− | ** | + | ** 933555 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 950451 |
− | * | + | * centisome position: |
− | ** | + | ** 16.631538 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0146_0041 |
+ | ** Esi0146_0041 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[UBIQUITIN--PROTEIN-LIGASE-RXN]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * | + | *** Assignment: go-term |
− | == | + | == Pathways associated == |
− | * [[ | + | * [[PWY-7511]] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=933555}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=950451}} | |
− | + | {{#set: centisome position=16.631538 }} | |
− | + | {{#set: common name=Esi_0146_0041|Esi0146_0041}} | |
− | + | {{#set: reaction associated=UBIQUITIN--PROTEIN-LIGASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-7511}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:39, 21 March 2018
Gene Ec-09_000720
- left end position:
- 933555
- transcription direction:
- NEGATIVE
- right end position:
- 950451
- centisome position:
- 16.631538
- Synonym(s):
- Esi_0146_0041
- Esi0146_0041
Reactions associated
- Reaction: UBIQUITIN--PROTEIN-LIGASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome