Difference between revisions of "CPD0-2231"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11374 RXN-11374] == * direction: ** LEFT-TO-RIGHT * common name: ** Diphthine synthase, putativ...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2231 CPD0-2231] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11374 RXN-11374] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2231 CPD0-2231] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))
 +
* inchi key:
 +
** InChIKey=BKUSIKGSPSFQAC-RRKCRQDMSA-K
 
* common name:
 
* common name:
−
** Diphthine synthase, putative
+
** dIDP
 +
* molecular weight:
 +
** 409.165   
 
* Synonym(s):
 
* Synonym(s):
 +
** deoxyinosine diphosphate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[2-3-CARBOXY-3-METHYLAMMONIOPROPYL-L-]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[3-carboxy-3-dimethylammonio-propyl-L-his]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[RXN-14228]]
−
** 1 a 2-[(3S)-3-carboxy-3-(methylammonio)propyl]-L-histidine-[translation elongation factor 2][c] '''+''' 1 S-adenosyl-L-methionine[c] '''=>''' 1 H+[c] '''+''' 1 a 2-[(3S)-3-carboxy-3-(dimethylammonio)propyl]-L-histidine-[translation elongation factor 2][c] '''+''' 1 S-adenosyl-L-homocysteine[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-21_006260]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* LIGAND-CPD:
−
** [http://www.genome.jp/dbget-bin/www_bget?R08468 R08468]
+
** [http://www.genome.jp/dbget-bin/www_bget?C01344 C01344]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: common name=Diphthine synthase, putative}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62286 62286]
−
{{#set: gene associated=Ec-21_006260}}
+
* BIGG : 37395
−
{{#set: in pathway=}}
+
* PUBCHEM:
−
{{#set: reconstruction category=annotation}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173552 46173552]
−
{{#set: reconstruction tool=pathwaytools}}
+
* HMDB : HMDB03536
−
{{#set: reconstruction source=esiliculosus_genome}}
+
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))}}
 +
{{#set: inchi key=InChIKey=BKUSIKGSPSFQAC-RRKCRQDMSA-K}}
 +
{{#set: common name=dIDP}}
 +
{{#set: molecular weight=409.165    }}
 +
{{#set: common name=deoxyinosine diphosphate}}
 +
{{#set: reversible reaction associated=RXN-14228}}

Latest revision as of 19:39, 21 March 2018

Metabolite CPD0-2231

  • smiles:
    • C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))
  • inchi key:
    • InChIKey=BKUSIKGSPSFQAC-RRKCRQDMSA-K
  • common name:
    • dIDP
  • molecular weight:
    • 409.165
  • Synonym(s):
    • deoxyinosine diphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD0-2231&oldid=28440"