Difference between revisions of "Ec-01 001610"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-315 CPD-315] == * smiles: ** CC4(=C(C)C=C3(N2(C%12(OC(CO)C(OP(=O)(O[CH](C)CNC(=O)CCC1(C)(C(...")
 
(Created page with "Category:Gene == Gene Ec-01_001610 == * left end position: ** 1286185 * transcription direction: ** POSITIVE * right end position: ** 1289470 * centisome position: ** 12.4...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-315 CPD-315] ==
+
== Gene Ec-01_001610 ==
−
* smiles:
+
* left end position:
−
** CC4(=C(C)C=C3(N2(C%12(OC(CO)C(OP(=O)(O[CH](C)CNC(=O)CCC1(C)(C(CC(=O)N)[CH]%11(C8(C)(C(CC(=O)N)(C)C(CCC(=O)N)C7(C(C)=C%10(C(CC(=O)N)(C)C(CCC(=O)N)C9(C=C6(C(C)(C)C(CCC(=O)N)C5(C(C)=C1N([Co---]([N+](=C2)C3=C4)(C#N)([N+]=56)([N+]=78)[N+]=9%10)%11)))))))))[O-])C(O)%12))))
+
** 1286185
−
* inchi key:
+
* transcription direction:
−
** InChIKey=RMRCNWBMXRMIRW-WZHZPDAFSA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** cyanocob(III)alamin
+
** 1289470
−
* molecular weight:
+
* centisome position:
−
** 1355.377    
+
** 12.464441    
 
* Synonym(s):
 
* Synonym(s):
−
** cyanocobalamin
+
** Esi_0112_0027
−
** rubramin
+
** Esi0112_0027
−
** vitamin B12
+
** SATase
−
** alphamine
+
−
** crystamine
+
−
** cyanoject
+
−
** cyomin
+
−
** cytamen
+
−
** hydrobexan
+
−
** rubesol
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[TransportSeed_CPD-315]]
+
* Reaction: [[SERINE-O-ACETTRAN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[TransportSeed_CPD-315]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
−
* [[ExchangeSeed_CPD-315]]
+
* [[CYSTSYN-PWY]]
 +
* [[PWY-7274]]
 +
* [[PWY-6936]]
 
== External links  ==
 
== External links  ==
−
* CAS : 68-19-9
+
{{#set: left end position=1286185}}
−
* DRUGBANK : DB00115
+
{{#set: transcription direction=POSITIVE}}
−
* PUBCHEM:
+
{{#set: right end position=1289470}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678590 70678590]
+
{{#set: centisome position=12.464441   }}
−
* HMDB : HMDB00607
+
{{#set: common name=Esi_0112_0027|Esi0112_0027|SATase}}
−
* LIGAND-CPD:
+
{{#set: reaction associated=SERINE-O-ACETTRAN-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02823 C02823]
+
{{#set: pathway associated=CYSTSYN-PWY|PWY-7274|PWY-6936}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17439 17439]
+
−
{{#set: smiles=CC4(=C(C)C=C3(N2(C%12(OC(CO)C(OP(=O)(O[CH](C)CNC(=O)CCC1(C)(C(CC(=O)N)[CH]%11(C8(C)(C(CC(=O)N)(C)C(CCC(=O)N)C7(C(C)=C%10(C(CC(=O)N)(C)C(CCC(=O)N)C9(C=C6(C(C)(C)C(CCC(=O)N)C5(C(C)=C1N([Co---]([N+](=C2)C3=C4)(C#N)([N+]=56)([N+]=78)[N+]=9%10)%11)))))))))[O-])C(O)%12))))}}
+
−
{{#set: inchi key=InChIKey=RMRCNWBMXRMIRW-WZHZPDAFSA-L}}
+
−
{{#set: common name=cyanocob(III)alamin}}
+
−
{{#set: molecular weight=1355.377   }}
+
−
{{#set: common name=cyanocobalamin|rubramin|vitamin B12|alphamine|crystamine|cyanoject|cyomin|cytamen|hydrobexan|rubesol}}
+
−
{{#set: consumed by=TransportSeed_CPD-315}}
+
−
{{#set: produced by=TransportSeed_CPD-315}}
+
−
{{#set: consumed or produced by=ExchangeSeed_CPD-315}}
+

Latest revision as of 19:39, 21 March 2018

Gene Ec-01_001610

  • left end position:
    • 1286185
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1289470
  • centisome position:
    • 12.464441
  • Synonym(s):
    • Esi_0112_0027
    • Esi0112_0027
    • SATase

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-01_001610&oldid=28500"