Difference between revisions of "CPD-15666"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14136 RXN-14136] == * direction: ** LEFT-TO-RIGHT * common name: ** glycerophosphodiester phosp...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15666 CPD-15666] == * smiles: ** CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14136 RXN-14136] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15666 CPD-15666] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* inchi key:
 +
** InChIKey=OOSDLBAXVXKFIB-GTUBXKNVSA-J
 
* common name:
 
* common name:
** glycerophosphodiester phosphodiesterase
+
** 6-cis, 2-trans-tridecadienoyl-CoA
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/3.1.4.46 EC-3.1.4.46]
+
** 955.803   
 
* Synonym(s):
 
* Synonym(s):
 +
** 6Z, 2E-tridecadienoyl-CoA
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[WATER]][c] '''+''' 1 [[CPD0-2030]][c] '''=>''' 1 [[GLYCEROL-3P]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[SER]][c]
+
* [[RXN-14771]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 H2O[c] '''+''' 1 glycerophosphoserine[c] '''=>''' 1 sn-glycerol 3-phosphate[c] '''+''' 1 H+[c] '''+''' 1 L-serine[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Ec-23_002410]]
+
** ESILICULOSUS_GENOME
+
***GO-TERM
+
* [[Ec-23_002720]]
+
** ESILICULOSUS_GENOME
+
***GO-TERM
+
== Pathways  ==
+
== Reconstruction information  ==
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
* RHEA:
+
* PUBCHEM:
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=29878 29878]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658546 90658546]
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: common name=glycerophosphodiester phosphodiesterase}}
+
{{#set: inchi key=InChIKey=OOSDLBAXVXKFIB-GTUBXKNVSA-J}}
{{#set: ec number=EC-3.1.4.46}}
+
{{#set: common name=6-cis, 2-trans-tridecadienoyl-CoA}}
{{#set: gene associated=Ec-23_002410|Ec-23_002720}}
+
{{#set: molecular weight=955.803    }}
{{#set: in pathway=}}
+
{{#set: common name=6Z, 2E-tridecadienoyl-CoA}}
{{#set: reconstruction category=annotation}}
+
{{#set: produced by=RXN-14771}}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: reconstruction source=esiliculosus_genome}}
+

Latest revision as of 19:39, 21 March 2018

Metabolite CPD-15666

  • smiles:
    • CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=OOSDLBAXVXKFIB-GTUBXKNVSA-J
  • common name:
    • 6-cis, 2-trans-tridecadienoyl-CoA
  • molecular weight:
    • 955.803
  • Synonym(s):
    • 6Z, 2E-tridecadienoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.