Difference between revisions of "SULFITE-REDUCTASE-FERREDOXIN-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINE NICOTINE] == * smiles: ** C1(CC[CH]([N+](C)1)C2(C=NC=CC=2)) * inchi key: ** InChIKey=S...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SULFITE-REDUCTASE-FERREDOXIN-RXN SULFITE-REDUCTASE-FERREDOXIN-RXN] == * direction: ** LEFT-TO-RIGHT...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SULFITE-REDUCTASE-FERREDOXIN-RXN SULFITE-REDUCTASE-FERREDOXIN-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Sulfite reductase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.8.7.1 EC-1.8.7.1] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[SO3]][c] '''+''' 6 [[Reduced-ferredoxins]][c] '''+''' 8 [[PROTON]][c] '''=>''' 1 [[HS]][c] '''+''' 3 [[WATER]][c] '''+''' 6 [[Oxidized-ferredoxins]][c] |
− | == | + | * With common name(s): |
− | == | + | ** 1 sulfite[c] '''+''' 6 a reduced ferredoxin [iron-sulfur] cluster[c] '''+''' 8 H+[c] '''=>''' 1 hydrogen sulfide[c] '''+''' 3 H2O[c] '''+''' 6 an oxidized ferredoxin [iron-sulfur] cluster[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-02_004340]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Gene: [[Ec-02_004330]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[SULFMETII-PWY]], sulfate reduction II (assimilatory): [http://metacyc.org/META/NEW-IMAGE?object=SULFMETII-PWY SULFMETII-PWY] | ||
+ | ** '''2''' reactions found over '''3''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-RXN: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00859 R00859] |
− | * | + | * UNIPROT: |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/O82802 O82802] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q42590 Q42590] |
− | * | + | ** [http://www.uniprot.org/uniprot/P72854 P72854] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/O23813 O23813] |
− | + | ** [http://www.uniprot.org/uniprot/Q9LZ66 Q9LZ66] | |
− | ** [http://www. | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | + | {{#set: common name=Sulfite reductase}} | |
− | ** [http://www. | + | {{#set: ec number=EC-1.8.7.1}} |
− | {{#set: | + | {{#set: gene associated=Ec-02_004340|Ec-02_004330}} |
− | {{#set: | + | {{#set: in pathway=SULFMETII-PWY}} |
− | {{#set: | + | {{#set: reconstruction category=orthology|annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
− | {{#set: | + |
Latest revision as of 19:39, 21 March 2018
Contents
Reaction SULFITE-REDUCTASE-FERREDOXIN-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- Sulfite reductase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 SO3[c] + 6 Reduced-ferredoxins[c] + 8 PROTON[c] => 1 HS[c] + 3 WATER[c] + 6 Oxidized-ferredoxins[c]
- With common name(s):
- 1 sulfite[c] + 6 a reduced ferredoxin [iron-sulfur] cluster[c] + 8 H+[c] => 1 hydrogen sulfide[c] + 3 H2O[c] + 6 an oxidized ferredoxin [iron-sulfur] cluster[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-02_004340
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome
- Gene: Ec-02_004330
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
- SULFMETII-PWY, sulfate reduction II (assimilatory): SULFMETII-PWY
- 2 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links