Difference between revisions of "MMUM-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1302 CPD-1302] == * smiles: ** CN1([CH](CNC2(N=C(NC(=O)C1=2)N))CNC3(=CC=C(C(=O)NC(C([O-])=O...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MMUM-RXN MMUM-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Homocysteine S-methyltransfer...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1302 CPD-1302] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=MMUM-RXN MMUM-RXN] ==
−
* smiles:
+
* direction:
−
** CN1([CH](CNC2(N=C(NC(=O)C1=2)N))CNC3(=CC=C(C(=O)NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(=O)[O-])=O)=O)C=C3))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=HVRNKDVLFAVCJF-VJANTYMQSA-J
+
 
* common name:
 
* common name:
−
** N5-methyl--tetrahydropteroyl tri-L-glutamate
+
** Homocysteine S-methyltransferase
−
* molecular weight:
+
* ec number:
−
** 713.66   
+
** [http://enzyme.expasy.org/EC/2.1.1.10 EC-2.1.1.10]
 
* Synonym(s):
 
* Synonym(s):
−
** N5-methyl--H4PteGlu3
 
−
** 5-methyltetrahydropteroyl tri-L-glutamate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-12730]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-397]][c] '''+''' 1 [[HOMO-CYS]][c] '''=>''' 2 [[MET]][c] '''+''' 1 [[PROTON]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[HOMOCYSMET-RXN]]
+
** 1 S-methyl-L-methionine[c] '''+''' 1 L-homocysteine[c] '''=>''' 2 L-methionine[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-06_000980]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[Ec-11_005000]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[ADENOSYLHOMOCYSCAT-PWY]], L-methionine salvage from L-homocysteine: [http://metacyc.org/META/NEW-IMAGE?object=ADENOSYLHOMOCYSCAT-PWY ADENOSYLHOMOCYSCAT-PWY]
 +
** '''2''' reactions found over '''3''' reactions in the full pathway
 +
* [[PWY-702]], L-methionine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-702 PWY-702]
 +
** '''6''' reactions found over '''6''' reactions in the full pathway
 +
* [[PWY-5441]], S-methyl-L-methionine cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5441 PWY-5441]
 +
** '''1''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852302 49852302]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=26337 26337]
−
* CHEMSPIDER:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.chemspider.com/Chemical-Structure.17625689.html 17625689]
+
{{#set: common name=Homocysteine S-methyltransferase}}
−
* CHEBI:
+
{{#set: ec number=EC-2.1.1.10}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58207 58207]
+
{{#set: gene associated=Ec-06_000980|Ec-11_005000}}
−
* LIGAND-CPD:
+
{{#set: in pathway=ADENOSYLHOMOCYSCAT-PWY|PWY-702|PWY-5441}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04489 C04489]
+
{{#set: reconstruction category=annotation}}
−
* HMDB : HMDB12177
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: smiles=CN1([CH](CNC2(N=C(NC(=O)C1=2)N))CNC3(=CC=C(C(=O)NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(=O)[O-])=O)=O)C=C3))}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: inchi key=InChIKey=HVRNKDVLFAVCJF-VJANTYMQSA-J}}
+
−
{{#set: common name=N5-methyl--tetrahydropteroyl tri-L-glutamate}}
+
−
{{#set: molecular weight=713.66    }}
+
−
{{#set: common name=N5-methyl--H4PteGlu3|5-methyltetrahydropteroyl tri-L-glutamate}}
+
−
{{#set: consumed by=RXN-12730}}
+
−
{{#set: consumed or produced by=HOMOCYSMET-RXN}}
+

Latest revision as of 19:39, 21 March 2018

Reaction MMUM-RXN

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Homocysteine S-methyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 S-methyl-L-methionine[c] + 1 L-homocysteine[c] => 2 L-methionine[c] + 1 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=MMUM-RXN&oldid=28526"