Difference between revisions of "Ec-11 005510"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12897 CPD-12897] == * smiles: ** CC(C)=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
 
(Created page with "Category:Gene == Gene Ec-11_005510 == * left end position: ** 5511573 * transcription direction: ** POSITIVE * right end position: ** 5516739 * centisome position: ** 87.6...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12897 CPD-12897] ==
+
== Gene Ec-11_005510 ==
−
* smiles:
+
* left end position:
−
** CC(C)=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 5511573
−
* inchi key:
+
* transcription direction:
−
** InChIKey=LPMIXVANMSEERY-FUEUKBNZSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 7-methyl-3-oxooct-6-enoyl-CoA
+
** 5516739
−
* molecular weight:
+
* centisome position:
−
** 915.695    
+
** 87.62914    
 
* Synonym(s):
 
* Synonym(s):
−
** 7-methyl-3-oxo-6-octenoyl-CoA
+
** Esi_0031_0033
 +
** Esi0031_0033
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-11917]]
+
* Reaction: [[GDPMANDEHYDRA-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
** Source: [[orthology-aragem]]
 +
== Pathways associated ==
 +
* [[GDPRHAMSYN-PWY]]
 +
* [[PWY-7573]]
 +
* [[PWY-5740]]
 +
* [[PWY-66]]
 +
* [[PWY-5738]]
 +
* [[PWY-5739]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=5511573}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986200 50986200]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=5516739}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71410 71410]
+
{{#set: centisome position=87.62914   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0031_0033|Esi0031_0033}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16466 C16466]
+
{{#set: reaction associated=GDPMANDEHYDRA-RXN}}
−
* HMDB : HMDB60421
+
{{#set: pathway associated=GDPRHAMSYN-PWY|PWY-7573|PWY-5740|PWY-66|PWY-5738|PWY-5739}}
−
{{#set: smiles=CC(C)=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=LPMIXVANMSEERY-FUEUKBNZSA-J}}
+
−
{{#set: common name=7-methyl-3-oxooct-6-enoyl-CoA}}
+
−
{{#set: molecular weight=915.695   }}
+
−
{{#set: common name=7-methyl-3-oxo-6-octenoyl-CoA}}
+
−
{{#set: consumed by=RXN-11917}}
+

Latest revision as of 20:40, 21 March 2018

Gene Ec-11_005510

  • left end position:
    • 5511573
  • transcription direction:
    • POSITIVE
  • right end position:
    • 5516739
  • centisome position:
    • 87.62914
  • Synonym(s):
    • Esi_0031_0033
    • Esi0031_0033

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-11_005510&oldid=28557"